- Aceglutamide
-
- $1.00 / 1kg
-
2026-01-05
- CAS:2490-97-3
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 10 mt
- Aceglutamide
-
- $45.00/ kg
-
2025-04-15
- CAS:2490-97-3
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 5000kg/week
- aceglutamide
-
- $0.00 / 1g
-
2024-12-24
- CAS:2490-97-3
- Min. Order: 1g
- Purity: 99.99%
- Supply Ability: 20 tons
|
| | Aceglutamide Basic information |
| | Aceglutamide Chemical Properties |
| Melting point | 206-208 °C | | alpha | 20D -12.5° (c = 2.9 in water) | | Boiling point | 604.9±50.0 °C(Predicted) | | density | 1.382 g/cm3 | | refractive index | -12 ° (C=3, H2O) | | storage temp. | 2-8°C | | solubility | PBS (pH 7.2): 2 mg/ml | | pka | 3.52±0.10(Predicted) | | form | Crystalline | | color | White | | Water Solubility | almost transparency | | Merck | 14,25 | | BRN | 1727471 | | Cosmetics Ingredients Functions | SKIN CONDITIONING | | InChI | 1S/C7H12N2O4/c1-4(10)9-5(7(12)13)2-3-6(8)11/h5H,2-3H2,1H3,(H2,8,11)(H,9,10)(H,12,13)/t5-/m0/s1 | | InChIKey | KSMRODHGGIIXDV-YFKPBYRVSA-N | | SMILES | CC(=O)N[C@@H](CCC(N)=O)C(O)=O | | LogP | -2.635 (est) | | CAS DataBase Reference | 2490-97-3(CAS DataBase Reference) | | EPA Substance Registry System | L-Glutamine, N2-acetyl- (2490-97-3) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29241990 | | Storage Class | 11 - Combustible Solids |
| | Aceglutamide Usage And Synthesis |
| Chemical Properties | Crystalline | | Uses | nootropic | | Definition | ChEBI: A glutamine derivative with an acetyl group bound at the alpha-amino group. | | IC 50 | Human Endogenous Metabolite |
| | Aceglutamide Preparation Products And Raw materials |
|