|
|
| | 3-Chloro-4-hydroxyaniline Basic information |
| | 3-Chloro-4-hydroxyaniline Chemical Properties |
| Melting point | 150-153 °C(lit.) | | Boiling point | 292.7±25.0 °C(Predicted) | | density | 1.406±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 8.75±0.18(Predicted) | | form | Solid | | color | Dark Brown | | Stability: | Stable. Incompatible with strong oxidizing agents. | | InChI | InChI=1S/C6H6ClNO/c7-5-3-4(8)1-2-6(5)9/h1-3,9H,8H2 | | InChIKey | ZYZQSCWSPFLAFM-UHFFFAOYSA-N | | SMILES | C1(O)=CC=C(N)C=C1Cl | | CAS DataBase Reference | 3964-52-1(CAS DataBase Reference) |
| | 3-Chloro-4-hydroxyaniline Usage And Synthesis |
| Chemical Properties | solid | | Uses | 4-Amino-2-chlorophenol may be used in the synthesis of the following compounds:
- N-(3-chloro-4-hydroxyphenyl)-N′,N′-dimethylurea
- 1,4-diketo-3-((4-[N-(3-chloro-4-hydroxyphenyl)amino]sulfonyl)phenyl)-6-phenylpyrrolo[3,4-c]pyrrole, a novel fluorescent pH-indicator
- 4-(4-aminophenoxy)-N-(4-(4-aminophenoxy) benzylidene)-3-chloroaniline
- 4-(4-amino-3-methylphenoxy)-N-(4-(4-amino-3-methylphenoxy)benzylidene)-3-chloroaniline
- 4-(4-amino-2-methylphenoxy)-N-(4-(4-amino-2-methylphenoxy)benzylidene)-3-chloroaniline
| | General Description | 4-Amino-2-chlorophenol (4A2CP) is a chlorinated aniline. Nephrotoxic potential of 4-amino-2-chlorophenol and its comparison with 4-aminophenol, 4-amino-2-chlorophenol, 4-amino-3-chlorophenol and 4-amino-2,6-dichlorophenol using isolated renal cortical cells from male Fischer 344 rats has been investigated. |
| | 3-Chloro-4-hydroxyaniline Preparation Products And Raw materials |
|