|
|
| | 4-Oxocyclohexanecarboxylic acid Basic information |
| | 4-Oxocyclohexanecarboxylic acid Chemical Properties |
| Melting point | 65-71℃ | | Boiling point | 210 °C(Press: 25 Torr) | | density | 1.233±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO, Methanol | | form | Solid | | pka | 4.43±0.20(Predicted) | | color | Off-White | | InChI | InChI=1S/C7H10O3/c8-6-3-1-5(2-4-6)7(9)10/h5H,1-4H2,(H,9,10) | | InChIKey | OWLXUYGCLDGHJJ-UHFFFAOYSA-N | | SMILES | C1(C(O)=O)CCC(=O)CC1 | | CAS DataBase Reference | 874-61-3(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 22-41 | | Safety Statements | 26-39 | | WGK Germany | 3 | | HS Code | 2918300090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |
| | 4-Oxocyclohexanecarboxylic acid Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | 4-Oxocyclohexanecarboxylic Acid is used in the preparation of Indomethacin (I641000) analogues used in the treatment of prostate cancer. In addition it is used in the synthesis of β-alanine derivatives as glucagon receptor antagonists. | | Definition | ChEBI: A 5-oxo monocarboxylic acid that is cyclohexanone in which one of the hydrogens at position 4 is substituted by a carboxylic acid group. |
| | 4-Oxocyclohexanecarboxylic acid Preparation Products And Raw materials |
|