|
|
| | 2-(Perfluorobutyl)ethyl methacrylate Basic information |
| Product Name: | 2-(Perfluorobutyl)ethyl methacrylate | | Synonyms: | 1H,1H,2H,2H-PERFLUOROHEXYL METHACRYLATE;(1H,1H,2H,2H-NONAFLUOROHEXYL)METHACRYLATE;2-(PERFLUOROBUTYL)ETHYL METHACRYLATE;2-(NONAFLUOROBUTYL)ETHYL METHACRYLATE;2-propenoicacid,2-methyl-,3,3,4,4,5,5,6,6,6-nonafluorohexylester;DAIKIN M-1420;2-Methylpropenoic acid 3,3,4,4,5,5,6,6,6-nonafluorohexyl ester;1H,1H,2H,2H-Perfluorohexyl methacrylate 97% | | CAS: | 1799-84-4 | | MF: | C10H9F9O2 | | MW: | 332.16 | | EINECS: | 217-287-5 | | Product Categories: | | | Mol File: | 1799-84-4.mol |  |
| | 2-(Perfluorobutyl)ethyl methacrylate Chemical Properties |
| Boiling point | 60 °C | | density | 1.402 | | refractive index | 1.353 | | Fp | 79 °C | | storage temp. | Sealed in dry,2-8°C | | Water Solubility | Insoluble in water | | solubility | Chloroform (Sparingly), Methanol (Slightly) | | form | clear liquid | | color | Colorless to Almost colorless | | Specific Gravity | 1.402 | | Stability: | Light Sensitive | | InChI | InChI=1S/C10H9F9O2/c1-5(2)6(20)21-4-3-7(11,12)8(13,14)9(15,16)10(17,18)19/h1,3-4H2,2H3 | | InChIKey | TYNRPOFACABVSI-UHFFFAOYSA-N | | SMILES | C(OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(=O)C(C)=C | | CAS DataBase Reference | 1799-84-4(CAS DataBase Reference) | | EPA Substance Registry System | 3,3,4,4,5,5,6,6,6-Nonafluorohexyl methacrylate (1799-84-4) |
| | 2-(Perfluorobutyl)ethyl methacrylate Usage And Synthesis |
| Uses | Perfluorobutylethyl Methacrylate was used to prepare fluorinated latexes by polymerization of miniemulsions as fluorinated monomers.Along with Perfluorodecylethyl Methacrylate (P286590), Perfluorobutylethyl Methacrylate was one of the pollutants from Great Lakes studied. |
| | 2-(Perfluorobutyl)ethyl methacrylate Preparation Products And Raw materials |
|