|
|
| | 2-Pentanol, 1,1',1'',1'''-(1,2-ethandiyldinitrilo) tetrakis Basic information | | Application |
| | 2-Pentanol, 1,1',1'',1'''-(1,2-ethandiyldinitrilo) tetrakis Chemical Properties |
| Boiling point | 480.0±12.0 °C(Predicted) | | density | 1.017±0.06 g/cm3(Predicted) | | pka | 14.19±0.20(Predicted) | | InChI | InChI=1S/C22H48N2O4/c1-5-9-19(25)15-23(16-20(26)10-6-2)13-14-24(17-21(27)11-7-3)18-22(28)12-8-4/h19-22,25-28H,5-18H2,1-4H3 | | InChIKey | WSANZYFPFILJKZ-UHFFFAOYSA-N | | SMILES | C(N(CC(O)CCC)CC(O)CCC)CN(CC(O)CCC)CC(O)CCC |
| | 2-Pentanol, 1,1',1'',1'''-(1,2-ethandiyldinitrilo) tetrakis Usage And Synthesis |
| Application | QCS antistatic agent can be used as a static eliminator in wool spinning, chemical fiber and other industries. |
| | 2-Pentanol, 1,1',1'',1'''-(1,2-ethandiyldinitrilo) tetrakis Preparation Products And Raw materials |
|