| Company Name: |
Chemsky（shanghai）International Co.,Ltd.
|
| Tel: |
021-50135380 |
| Email: |
shchemsky@sina.com |
| Products Intro: |
Product Name:NiM-Benzyl-L-histidine Methyl ester dihydrochloride
Purity:98%+ Package:1500RMB/1G; 3300RMB/5G
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:H-His(Bzl)-OMe dihydrochloride
|
| Company Name: |
Santa Cruz Biotechnology Inc
|
| Tel: |
021-60936350 |
| Email: |
scbt@scbt.com |
| Products Intro: |
Product Name:Nim-Benzyl-L-histidine methyl ester dihydrochloride
|
| Company Name: |
United States Biological
|
| Tel: |
1-800-520-3011 |
| Email: |
sales@advtechind.com |
| Products Intro: |
Product Name:Nim-Benzyl-L-histidine methyl ester dihydrochloride
|
|
| | H-HIS(BZL)-OME 2 HCL Basic information |
| Product Name: | H-HIS(BZL)-OME 2 HCL | | Synonyms: | H-HIS(BZL)-OME 2 HCL;HISTIDINE(BZL)-OME 2 HCL;N-IM-BENZYL-L-HISTIDINE METHYL ESTER DIHYDROCHLORIDE;H-His(Bzl)-OMe dihydrochloride;L-His(Bzl)-OMe·2HCl;Nim-Benzyl-L-histidine methyl ester dihydrochloride≥ 98% (TLC) | | CAS: | | | MF: | C14H19Cl2N3O2 | | MW: | 332.23 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | H-HIS(BZL)-OME 2 HCL Chemical Properties |
| form | solid | | InChI | 1S/C14H17N3O2.2ClH/c1-19-14(18)13(15)7-12-9-17(10-16-12)8-11-5-3-2-4-6-11;;/h2-6,9-10,13H,7-8,15H2,1H3;2*1H/t13-;;/m0../s1 | | InChIKey | ACAJLNMXSIOPSZ-GXKRWWSZSA-N | | SMILES | Cl.Cl.COC(=O)[C@@H](N)Cc1cn(Cc2ccccc2)cn1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | H-HIS(BZL)-OME 2 HCL Usage And Synthesis |
| Chemical Properties | White powder |
| | H-HIS(BZL)-OME 2 HCL Preparation Products And Raw materials |
|