2-(1H-pyrrol-2-ylmethyl)-1H-pyrrole manufacturers
|
| | 2-(1H-pyrrol-2-ylmethyl)-1H-pyrrole Basic information |
| | 2-(1H-pyrrol-2-ylmethyl)-1H-pyrrole Chemical Properties |
| Melting point | 72.0 to 77.0 °C | | Boiling point | 120°C/2mmHg(lit.) | | density | 1.0976 (rough estimate) | | refractive index | 1.5600 (estimate) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | solubility | Chloroform, Methanol | | form | Solid | | pka | 17.25±0.50(Predicted) | | color | Green Grey | | λmax | 449nm(CHCl3)(lit.) | | InChI | InChI=1S/C9H10N2/c1-3-8(10-5-1)7-9-4-2-6-11-9/h1-6,10-11H,7H2 | | InChIKey | PBTPREHATAFBEN-UHFFFAOYSA-N | | SMILES | C(C1=CC=CN1)C1=CC=CN1 |
| | 2-(1H-pyrrol-2-ylmethyl)-1H-pyrrole Usage And Synthesis |
| Chemical Properties | gray solid | | Uses | Dipyrromethane is a new organic reagent for the synthesis of gold nanoparticles. | | Definition | ChEBI: Dipyrromethane is a dipyrrole. | | Synthesis | The general procedure for the synthesis of di(1H-pyrrol-2-yl)methane from pyrrole and formaldehyde was as follows: paraformaldehyde (0.5 g, 16.7 mmol) was added to pyrrole (118 mL, 1.67 mol) as a solvent, followed by the addition of catalyst indium(III) chloride (370 mg, 1.67 mmol). The reaction mixture was stirred at room temperature for 10 h under argon protection. Subsequently, the reaction system was warmed up to 55 °C and stirring was continued for 6 hours. After completion of the reaction, sodium hydroxide (NaOH, 0.2 g, 83.5 mmol) was added and stirred for 4 hours. The reaction mixture was filtered and the filtrate was concentrated. The residue was purified by column chromatography using dichloromethane: hexane (1:1, v/v) as eluent to afford 2.05 g (yield: 84%) of the target compound di(1H-pyrrol-2-yl)methane as a white solid. | | References | [1] Tetrahedron, 2011, vol. 67, # 26, p. 4924 - 4932
[2] Monatshefte fur Chemie, 2004, vol. 135, # 10, p. 1265 - 1273
[3] Patent: KR101545325, 2015, B1. Location in patent: Paragraph 0096-0100
[4] Journal of the American Chemical Society, 2014, vol. 136, # 51, p. 17802 - 17807
[5] Angewandte Chemie - International Edition, 2015, vol. 54, # 2, p. 691 - 695 |
| | 2-(1H-pyrrol-2-ylmethyl)-1H-pyrrole Preparation Products And Raw materials |
|