|
|
| | Aschantin Basic information |
| Product Name: | Aschantin | | Synonyms: | Aschantin;(1β,5β)-2β-(3,4,5-Trimethoxyphenyl)-6β-(1,3-benzodioxole-5-yl)-3,7-dioxabicyclo[3.3.0]octane;5-[(1S,3aβ,6aβ)-Tetrahydro-4β-(3,4,5-trimethoxyphenyl)-1H,3H-furo[3,4-c]furan-1-yl]-1,3-benzodioxole;Ashantin | | CAS: | 13060-15-6 | | MF: | C22H24O7 | | MW: | 400.42176 | | EINECS: | | | Product Categories: | | | Mol File: | 13060-15-6.mol |  |
| | Aschantin Chemical Properties |
| storage temp. | -20°C | | solubility | water: slightly soluble | | form | solid | | biological source | plant | | Water Solubility | water: slightly soluble | | Major Application | metabolomics
vitamins, nutraceuticals, and natural products | | InChI | 1S/C22H24O7/c1-23-18-7-13(8-19(24-2)22(18)25-3)21-15-10-26-20(14(15)9-27-21)12-4-5-16-17(6-12)29-11-28-16/h4-8,14-15,20-21H,9-11H2,1-3H3/t14-,15-,20+,21+/m0/s1 | | InChIKey | ONDWGDNAFRAXCN-VUEDXXQZSA-N | | SMILES | O1[C@@H]([C@@H]3[C@@H]([C@H](OC3)c4cc5c(cc4)OCO5)C1)c2cc(c(c(c2)OC)OC)OC |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Aschantin Usage And Synthesis |
| Uses | It is a natural product derived from plant source th at finds application in compound screening libraries, metabolomics, phytochemical, and pharmaceutical research. | | Biological Activity | Aschantin has various biological activities including peroxynitrite scavenging capacity, inhibition of inducible NO synthetase, antiplasmodial activity, Ca2+-antagonistic activity, platelet activating factor-antagonistic activity, and chemo-preventative or therapeutic activity mediated via inhibition of mTOR kinase.', 'The anticancer activity of aschantin is achieved by inhibiting Akt, a protein th at plays a crucial role in promoting cancer cell growth and proliferation. By blocking Akt, aschantin disrupts multiple signaling pathways th at are essential for cancer cells to thrive and multiply. This disruption ultimately leads to the suppression of cancer cell proliferation, making it an effective strategy for combating cancer. |
| | Aschantin Preparation Products And Raw materials |
|