- Boc-Cys(mob)
-
- $0.00/ kg
-
2026-04-01
- CAS:18942-46-6
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
- Boc-Cys(mob)
-
- $1.00 / 1g
-
2020-01-06
- CAS:18942-46-6
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 100KG
- BOC-CYS(4-MEOBZL)-OH
-
- $7.00 / 1KG
-
2019-09-02
- CAS:18942-46-6
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 1000KG
|
| | BOC-CYS(4-MEOBZL)-OH Basic information |
| | BOC-CYS(4-MEOBZL)-OH Chemical Properties |
| Melting point | 127～130℃ | | Boiling point | 514.0±50.0 °C(Predicted) | | density | 1.205±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | pka | 3.57±0.10(Predicted) | | form | Solid | | Appearance | White to off-white Solid | | Optical Rotation | -42.80°(C=0.01g/mL, DMSO, 20°C, 589nm) | | Major Application | peptide synthesis | | InChI | 1S/C16H23NO5S/c1-16(2,3)22-15(20)17-13(14(18)19)10-23-9-11-5-7-12(21-4)8-6-11/h5-8,13H,9-10H2,1-4H3,(H,17,20)(H,18,19) | | InChIKey | VRTXRNJMNFVTOM-UHFFFAOYSA-N | | SMILES | S(CC(NC(=O)OC(C)(C)C)C(=O)O)Cc1ccc(cc1)OC | | CAS DataBase Reference | 18942-46-6(CAS DataBase Reference) | | EPA Substance Registry System | L-Cysteine, N-[(1,1-dimethylethoxy)carbonyl]-S-[(4-methoxyphenyl)methyl]- (18942-46-6) |
| WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 2930 90 16 | | Storage Class | 11 - Combustible Solids |
| | BOC-CYS(4-MEOBZL)-OH Usage And Synthesis |
| Uses | Boc-Cys(Mob)-OH, is a Cystine derivative, used in various chemical synthesis and peptide chemistry. | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | BOC-CYS(4-MEOBZL)-OH Preparation Products And Raw materials |
|