| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 1-Azido-4-bromobenzene Basic information | | Uses |
| Product Name: | 1-Azido-4-bromobenzene | | Synonyms: | 1-Bromo-4-azidobenzene;p-Bromophenyl azide;1-Azido-4-broMobenzene solution;4-Bromophenyl azide solution;1-Azido-4-bromobenzene ~0.5M solution in t-butyl methyl ether;1-Azido-4-bromobenzene | | CAS: | 2101-88-4 | | MF: | C6H4BrN3 | | MW: | 0 | | EINECS: | | | Product Categories: | | | Mol File: | 2101-88-4.mol |  |
| | 1-Azido-4-bromobenzene Chemical Properties |
| Melting point | 20°C | | Boiling point | 105 °C(Press: 10 Torr) | | density | 1.5827 | | refractive index | 1.6400 (estimate) | | Fp | -33℃ | | storage temp. | -20°C | | form | liquid | | BRN | 1939308 | | InChI | InChI=1S/C6H4BrN3/c7-5-1-3-6(4-2-5)9-10-8/h1-4H | | InChIKey | WHSJSMSBFMDFHK-UHFFFAOYSA-N | | SMILES | C1(N=[N+]=[N-])=CC=C(Br)C=C1 |
| Hazard Codes | F,T | | Risk Statements | 11-38-48/23/24/25 | | Safety Statements | 16 | | RIDADR | UN 2398 3 / PGII | | WGK Germany | 3 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2
Flam. Liq. 2
Skin Irrit. 2
STOT RE 1 |
| | 1-Azido-4-bromobenzene Usage And Synthesis |
| Uses | 1-Azide-4-bromobenzene is a hydrocarbon derivative used in organic synthesis and scientific research. | | Synthesis Reference(s) | Tetrahedron Letters, 17, p. 4421, 1976 DOI: 10.1016/0040-4039(76)80132-3 |
| | 1-Azido-4-bromobenzene Preparation Products And Raw materials |
|