| Company Name: |
Nextpeptide Inc |
| Tel: |
+86-0571-81612335 +8613336028439 |
| Email: |
sales@nextpeptide.com |
|
| | Benzenesulfonylamino-acetic acid Basic information |
| | Benzenesulfonylamino-acetic acid Chemical Properties |
| Melting point | 165° | | storage temp. | Store at room temperature | | form | solid | | Appearance | White to off-white Solid | | InChI | 1S/C8H9NO4S/c10-8(11)6-9-14(12,13)7-4-2-1-3-5-7/h1-5,9H,6H2,(H,10,11) | | InChIKey | WTSZSAHZIMPSDM-UHFFFAOYSA-N | | SMILES | [S](=O)(=O)(NCC(=O)O)c1ccccc1 |
| Hazard Codes | Xi | | Risk Statements | 41 | | Safety Statements | 26-39 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Dam. 1 |
| | Benzenesulfonylamino-acetic acid Usage And Synthesis |
| | Benzenesulfonylamino-acetic acid Preparation Products And Raw materials |
|