| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
LaaJoo |
| Tel: |
021-60702684 18516024827 |
| Email: |
huang.jiayi@sinocompound.com |
|
| | 2,6-Bis(di-t-butylphosphinomethyl)pyridine, 99% Basic information | | Uses |
| Product Name: | 2,6-Bis(di-t-butylphosphinomethyl)pyridine, 99% | | Synonyms: | 2,6-Bis(di-t-butylphosphinomethyl)pyridine,98%;ditert-butyl-[[6-(ditert-butylphosphanylmethyl)pyridin-2-yl]methyl]phosphane;Pyridine, 2,6-bis[[bis(1,1-dimethylethyl)phosphino]methyl]-;2,6-Bis((di-tert-butyL;itert-butyl-[[6-(ditert-butylphosphanylmethyl)pyridin-2-yl]methyl]phosphane;2,6-Bis(di-t-butylphosphinomethyl)pyridi;2,6-Bis(di-tert-butylphosphinomethyl)pyridine;2,6-Bis((di-tert-butylphosphino)methyl)pyridine | | CAS: | 338800-13-8 | | MF: | C23H43NP2 | | MW: | 395.54 | | EINECS: | | | Product Categories: | Achiral Phosphine;Aryl Phosphine;organophosphine ligand | | Mol File: | 338800-13-8.mol |  |
| | 2,6-Bis(di-t-butylphosphinomethyl)pyridine, 99% Chemical Properties |
| Melting point | 116-119°C | | Boiling point | 456.3±45.0 °C(Predicted) | | Fp | 67℃ | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | Powder | | pka | 5.72±0.24(Predicted) | | color | white to light-yellow | | Sensitive | air sensitive | | InChI | 1S/C23H43NP2/c1-20(2,3)25(21(4,5)6)16-18-14-13-15-19(24-18)17-26(22(7,8)9)23(10,11)12/h13-15H,16-17H2,1-12H3 | | InChIKey | NJQAVBPPWNSBBC-UHFFFAOYSA-N | | SMILES | CC(C)(C)P(Cc1cccc(CP(C(C)(C)C)C(C)(C)C)n1)C(C)(C)C |
| Hazard Codes | F,Xi | | Risk Statements | 14/15-36/37/38 | | Safety Statements | 26-36/37/39-43 | | RIDADR | UN 2813 4.3 / PGIII | | WGK Germany | 3 | | Storage Class | 4.3 - Hazardous materials which set free flammable gases upon contact with water | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3
Water-react 3 |
| | 2,6-Bis(di-t-butylphosphinomethyl)pyridine, 99% Usage And Synthesis |
| Uses | Di-tert-butylphosphine (1.25 g, 8.6 mmol) was added dropwise to a suspension of 2,6-bis(chloromethyl)pyridine (710 mg, 4.0 mmol) in methanol (3 mL). The mixture was heated to 45 °C and stirred for 2 days. After cooling to room temperature, triethylamine (1.25 mL) was slowly added, and a white precipitate formed. The solvent was evaporated under vacuum, and the compound 2,6-bis(di-tert-butylphosphomethyl)pyridine was separated from the residue by column chromatography (silica, solvent: chloroform) as a white solid. | | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling
reagent type: ligand |
| | 2,6-Bis(di-t-butylphosphinomethyl)pyridine, 99% Preparation Products And Raw materials |
|