|
|
| | 3,5-DIMETHYLADAMANTANE-1-ACIDIC ACID Basic information |
| Product Name: | 3,5-DIMETHYLADAMANTANE-1-ACIDIC ACID | | Synonyms: | 3,5-DIMETHYLADAMANTANE-1-ACIDIC ACID;3,5-DiMethyladaMantane-1-acetic acid;2-(3,5-DiMethyladaMantan-1-yl)acetic acid;3,5-DiMethyladaMantane-1-acetic acid;3,5-Dimethyladamantane-1-acetic acid 97%;3,5-Dimethyltricyclo[3.3.1.13,7]decane-1-acetic acid;2-(3,5-dimethyl-1-adamantyl)acetic acid;2-(3,5-dimethyl-1-adamantyl)ethanoic acid | | CAS: | 14202-14-3 | | MF: | C14H22O2 | | MW: | 222.32 | | EINECS: | | | Product Categories: | | | Mol File: | 14202-14-3.mol |  |
| | 3,5-DIMETHYLADAMANTANE-1-ACIDIC ACID Chemical Properties |
| Melting point | 113-114℃ (ethanol water ) | | Boiling point | 339.2±10.0 °C(Predicted) | | density | 1.134±0.06 g/cm3 (20 ºC 760 Torr) | | form | Powder | | pka | 4.72±0.10(Predicted) | | color | White to off-white | | Water Solubility | Slightly soluble in water. | | InChI | 1S/C14H22O2/c1-12-3-10-4-13(2,7-12)9-14(5-10,8-12)6-11(15)16/h10H,3-9H2,1-2H3,(H,15,16)/t10-,12+,13-,14- | | InChIKey | FUOXJVUIQUYDDI-OPAWKCGKSA-N | | SMILES | C[C@@]12CC3C[C@@](C)(C1)CC(C3)(CC(O)=O)C2 |
| WGK Germany | 3 | | HS Code | 2916200090 | | Storage Class | 11 - Combustible Solids |
| | 3,5-DIMETHYLADAMANTANE-1-ACIDIC ACID Usage And Synthesis |
| Uses | A commonly used as an organic reagent and pharmaceutical intermediate. |
| | 3,5-DIMETHYLADAMANTANE-1-ACIDIC ACID Preparation Products And Raw materials |
|