|
|
| | 4,5-Dichloro-7H-pyrrolo[2,3-d]pyrimidine Basic information |
| Product Name: | 4,5-Dichloro-7H-pyrrolo[2,3-d]pyrimidine | | Synonyms: | 4,5-Dichloro-7H-pyrrolo[2,3-d]pyrimidine;5-Chloro-4-chloro-7H-pyrrolo[2,3-d]pyrimidine;5-Chloro-4-chloro-7H-pyrr...;7H-Pyrrolo[2,3-d]pyrimidine, 4,5-dichloro-;4,5-dichloro-1H-pyrrolo[2,3-d]pyrimidine | | CAS: | 115093-90-8 | | MF: | C6H3Cl2N3 | | MW: | 188.01 | | EINECS: | | | Product Categories: | Heterocycle-Pyrimidine series;CHIRAL CHEMICALS | | Mol File: | 115093-90-8.mol | ![4,5-Dichloro-7H-pyrrolo[2,3-d]pyrimidine Structure](CAS/GIF/115093-90-8.gif) |
| | 4,5-Dichloro-7H-pyrrolo[2,3-d]pyrimidine Chemical Properties |
| Melting point | 290 °C | | Boiling point | 220.9±50.0 °C(Predicted) | | density | 1.79±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | pka | 9.52±0.20(Predicted) | | color | White to off-white | | InChI | InChI=1S/C6H3Cl2N3/c7-3-1-9-6-4(3)5(8)10-2-11-6/h1-2H,(H,9,10,11) | | InChIKey | VFTPONHUNNOSKG-UHFFFAOYSA-N | | SMILES | C1=NC(Cl)=C2C(Cl)=CNC2=N1 |
| | 4,5-Dichloro-7H-pyrrolo[2,3-d]pyrimidine Usage And Synthesis |
| Synthesis | GENERAL METHODS: 4-Chloropyrrolopyrimidine (20 mmol) was used as starting material, dissolved in N,N-dimethylformamide (DMF) (15 mL), followed by the addition of N-chlorosuccinimide (NCS) or N-bromosuccinimide (NBS) (21 mmol). The reaction mixture was stirred at room temperature for 72 hours. Upon completion of the reaction, ice water (150 mL) was slowly added to the mixture, precipitation was precipitated and the solid product was collected by filtration. The precipitate was washed with water (3 x 100 mL) and dried to give 4,5-dichloro-7H-pyrrolo[2,3-d]pyrimidine (3b) and possible by-products (3c). | | References | [1] Synthesis, 2011, # 9, p. 1442 - 1446
[2] Archiv der Pharmazie, 2016, vol. 349, # 5, p. 356 - 362
[3] European Journal of Medicinal Chemistry, 2017, vol. 138, p. 543 - 551
[4] Patent: CN107556318, 2018, A. Location in patent: Paragraph 0101-0105
[5] Journal of Medicinal Chemistry, 1988, vol. 31, # 11, p. 2086 - 2092 |
| | 4,5-Dichloro-7H-pyrrolo[2,3-d]pyrimidine Preparation Products And Raw materials |
|