|
|
| | 1,2,4]TRIAZOLO[4,3-A]PYRAZINE Basic information | | Uses |
| Product Name: | 1,2,4]TRIAZOLO[4,3-A]PYRAZINE | | Synonyms: | 1,2,4]TRIAZOLO[4,3-A]PYRAZINE;[1,2,4]Triazolo[4,3-a]pyrazine ,98.5% | | CAS: | 274-82-8 | | MF: | C5H4N4 | | MW: | 120.11 | | EINECS: | | | Product Categories: | | | Mol File: | 274-82-8.mol | ![1,2,4]TRIAZOLO[4,3-A]PYRAZINE Structure](CAS/GIF/274-82-8.gif) |
| | 1,2,4]TRIAZOLO[4,3-A]PYRAZINE Chemical Properties |
| density | 1.48±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 0.08±0.30(Predicted) | | Appearance | Light yellow to orange Solid | | InChI | InChI=1S/C5H4N4/c1-2-9-4-7-8-5(9)3-6-1/h1-4H | | InChIKey | NVSPJDGXKBDYIZ-UHFFFAOYSA-N | | SMILES | C12=NN=CN1C=CN=C2 |
| | 1,2,4]TRIAZOLO[4,3-A]PYRAZINE Usage And Synthesis |
| Uses | 1,2,4-Triazolo[4,3-A]pyrazine is a heterocyclic derivative, mainly used as a pharmaceutical intermediate. | | Chemical Properties | Brown solid |
| | 1,2,4]TRIAZOLO[4,3-A]PYRAZINE Preparation Products And Raw materials |
|