|
|
| | 2,2-Difluorobenzodioxole-5-carboxaldehyde Basic information |
| Product Name: | 2,2-Difluorobenzodioxole-5-carboxaldehyde | | Synonyms: | 2,2-Difluoro-5-formyl-1,3-benzodioxole, 3,4-(Difluoromethylenedioxy)benzaldehyde, 1,2-(Difluoromethylenedioxy)-4-formylbenzene;2,2-Difluorobenzo[d][1,3]dioxole-5-carbaldehyde;2,2-difluoro-2H-1,3-benzodioxole-5-carbaldehyde;2,2-Difluoro-5-formylbenzodioxole 97%;5-FORMYL-2,2-DIFLUOROBENZODIOXOLE;2,2-DIFLUORO-1,3-BENZODIOXOLE-5-CARBOXALDEHYDE;2,2-DIFLUORO-1,3-BENZODIOXOLE-5-CARBOXYALDEHYDE;2,2-DIFLUORO-5-FORMYL-1,3-BENZODIOXOLE | | CAS: | 656-42-8 | | MF: | C8H4F2O3 | | MW: | 186.11 | | EINECS: | | | Product Categories: | Heterocycles series;Benzodiozoles, Benzodioxines & Benzodioxepines;Aldehydes;Benzodiozoles, Benzodioxines & Benzodioxepines | | Mol File: | 656-42-8.mol |  |
| | 2,2-Difluorobenzodioxole-5-carboxaldehyde Chemical Properties |
| Boiling point | 202-203 °C(lit.) | | density | 1.422 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.5000(lit.) | | Fp | 205 °F | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | liquid | | color | Clear, colourless | | Water Solubility | Sparingly soluble in water (0.31 g/L at 25°C). | | Sensitive | Air Sensitive | | BRN | 1369253 | | InChI | 1S/C8H4F2O3/c9-8(10)12-6-2-1-5(4-11)3-7(6)13-8/h1-4H | | InChIKey | GGERGLKEDUUSAP-UHFFFAOYSA-N | | SMILES | [H]C(=O)c1ccc2OC(F)(F)Oc2c1 | | CAS DataBase Reference | 656-42-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 2932990090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2,2-Difluorobenzodioxole-5-carboxaldehyde Usage And Synthesis |
| Uses | 2,2-Difluoro-1,3-benzodioxole-5-carboxaldehyde is used as primary and secondary intermediate. |
| | 2,2-Difluorobenzodioxole-5-carboxaldehyde Preparation Products And Raw materials |
|