|
|
| | 2-Amino-3-nitrobenzamide Basic information |
| Product Name: | 2-Amino-3-nitrobenzamide | | Synonyms: | 2-Amino-3-nitrobenzamide;Benzamide, 2-amino-3-nitro-;Methyl2-Amino-3-nitro-benzamide;2-aMino-N-Methyl-3-nitrobenzaMide;2-AMino-3-nitrobenzaMid | | CAS: | 313279-12-8 | | MF: | C7H7N3O3 | | MW: | 181.15 | | EINECS: | 200-258-5 | | Product Categories: | | | Mol File: | 313279-12-8.mol |  |
| | 2-Amino-3-nitrobenzamide Chemical Properties |
| Melting point | 240-242℃ | | Boiling point | 319.2±22.0 °C(Predicted) | | density | 1.481±0.06 g/cm3 (20 ºC 760 Torr) | | storage temp. | 2-8°C(protect from light) | | solubility | Chloroform, DMSO, Methanol, THF | | form | Solid | | pka | 14.63±0.50(Predicted) | | color | Orange | | InChI | InChI=1S/C7H7N3O3/c8-6-4(7(9)11)2-1-3-5(6)10(12)13/h1-3H,8H2,(H2,9,11) | | InChIKey | RMLPQVFYXZMJES-UHFFFAOYSA-N | | SMILES | C(N)(=O)C1=CC=CC([N+]([O-])=O)=C1N |
| | 2-Amino-3-nitrobenzamide Usage And Synthesis |
| Chemical Properties | Yellow solid | | Uses | 2-Amino-3-nitrobenzamide is an intermediate in the synthesis of PARP-1 inhibitors, involved in DNA repair, and RNA transcription modulation. |
| | 2-Amino-3-nitrobenzamide Preparation Products And Raw materials |
|