|
|
| | 3-Methoxy-1(3H)-isobenzofuranone Basic information |
| Product Name: | 3-Methoxy-1(3H)-isobenzofuranone | | Synonyms: | 3-Methoxyisobenzofuran-1(3H)-one;3-Methoxy-1(3H)-isobenzofuranone;3-Methoxyphthalide;3-Methoxyphthalide>;1(3H)-Isobenzofuranone, 3-methoxy- | | CAS: | 4122-57-0 | | MF: | C9H8O3 | | MW: | 164.16 | | EINECS: | | | Product Categories: | | | Mol File: | 4122-57-0.mol |  |
| | 3-Methoxy-1(3H)-isobenzofuranone Chemical Properties |
| Melting point | 45 °C | | Boiling point | 146 °C / 12mmHg | | density | 1.25±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | color | Off-White | | InChI | InChI=1S/C9H8O3/c1-11-9-7-5-3-2-4-6(7)8(10)12-9/h2-5,9H,1H3 | | InChIKey | OIIJJGAFRGJQSQ-UHFFFAOYSA-N | | SMILES | C1(=O)C2=C(C=CC=C2)C(OC)O1 |
| | 3-Methoxy-1(3H)-isobenzofuranone Usage And Synthesis |
| Uses | 3-Methoxyisobenzofuran-1(3H)-one acts as a reagent for the synthesis of vitamin K and related naphthoquinones via demethoxycarbonylative cyclization and cascade Cope-retro-Wittig rearrangement. |
| | 3-Methoxy-1(3H)-isobenzofuranone Preparation Products And Raw materials |
|