|
|
| | DIACETAMIDE Basic information |
| | DIACETAMIDE Chemical Properties |
| Melting point | 75.5-76.5 °C (lit.) | | Boiling point | 222-223 °C (lit.) | | density | 1.3846 (rough estimate) | | refractive index | 1.4340 (estimate) | | solubility | Chloroform (Sparingly), Methanol (Slightly) | | form | Solid | | pka | 12.15±0.46(Predicted) | | color | White to Off-White | | InChI | InChI=1S/C4H7NO2/c1-3(6)5-4(2)7/h1-2H3,(H,5,6,7) | | InChIKey | ZSBDPRIWBYHIAF-UHFFFAOYSA-N | | SMILES | C(NC(C)=O)(=O)C | | CAS DataBase Reference | 625-77-4(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | DIACETAMIDE Usage And Synthesis |
| Chemical Properties | WHITE CRYSTALLINE POWDER OR CHUNKS | | Uses | N-Acetyl Acetamide is a useful reagent for organic synthesis. | | Purification Methods | Purify the amide by recrystallisation from MeOH [Arnett & Harrelson J Am Chem Soc 109 809 1987]. [Beilstein 2 H 181.] |
| | DIACETAMIDE Preparation Products And Raw materials |
|