|
|
| | 3,4,5-TRIFLUOROBENZONITRILE Basic information |
| Product Name: | 3,4,5-TRIFLUOROBENZONITRILE | | Synonyms: | 3,4,5-TRIFLUOROBENZONITRILE;3,4,5-TRIFLUORO-1-CYANO BENZENE;3,4,5-Trifluorobenzonitrile, 97+%;Benzonitrile, 3,4,5-trifluoro- (9CI);3-flurophenylacetic acid;3,4,5-Trifluorobenzonitrile 99%;3,4,5-Trifluorobenzonitrile99%;3,4,5-Trifluorobenzo | | CAS: | 134227-45-5 | | MF: | C7H2F3N | | MW: | 157.09 | | EINECS: | | | Product Categories: | Heterocyclic Acids,Thiophenes ,Thiazolines/Thiazolidines;Fluorine series;Aromatic Nitriles;Nitrile;C6 to C7;Cyanides/Nitriles;Nitrogen Compounds;HALIDE | | Mol File: | 134227-45-5.mol |  |
| | 3,4,5-TRIFLUOROBENZONITRILE Chemical Properties |
| Melting point | 45-47 °C(lit.) | | Boiling point | 72-73 °C10 mm Hg(lit.) | | density | 1.2465 (estimate) | | Fp | 145 °F | | storage temp. | 2-8°C | | solubility | soluble in Methanol | | form | powder to crystal | | color | White to Almost white | | BRN | 7702244 | | InChI | InChI=1S/C7H2F3N/c8-5-1-4(3-11)2-6(9)7(5)10/h1-2H | | InChIKey | XFKYJMGXZXJYBS-UHFFFAOYSA-N | | SMILES | C(#N)C1=CC(F)=C(F)C(F)=C1 | | CAS DataBase Reference | 134227-45-5(CAS DataBase Reference) |
| | 3,4,5-TRIFLUOROBENZONITRILE Usage And Synthesis |
| Chemical Properties | semi-transparent crystals |
| | 3,4,5-TRIFLUOROBENZONITRILE Preparation Products And Raw materials |
|