|
|
| | N-Fmoc-N'-trityl-D-histidine Basic information |
| | N-Fmoc-N'-trityl-D-histidine Chemical Properties |
| Melting point | 141-146°C | | Boiling point | 811.7±65.0 °C(Predicted) | | density | 1.24±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | pka | 3.06±0.10(Predicted) | | form | powder to crystal | | color | White to Light yellow | | Optical Rotation | [α]22/D -85.0°, c = 1% in chloroform | | Major Application | peptide synthesis | | InChIKey | XXMYDXUIZKNHDT-DIPNUNPCSA-N | | SMILES | C(O)(=O)[C@@H](CC1N=CN(C(C2=CC=CC=C2)(C2=CC=CC=C2)C2=CC=CC=C2)C=1)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O | | CAS DataBase Reference | 135610-90-1(CAS DataBase Reference) |
| WGK Germany | 3 | | HS Code | 2933 29 90 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 4 |
| | N-Fmoc-N'-trityl-D-histidine Usage And Synthesis |
| Chemical Properties | White powder | | Uses | Fmoc-D-His(Trt)-OH, is an amino acid derivative used in chemical synthesis and peptide chemistry. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | N-Fmoc-N'-trityl-D-histidine Preparation Products And Raw materials |
|