|
|
| | 1-(2-Methoxyphenyl)piperazine hydrochloride Basic information |
| | 1-(2-Methoxyphenyl)piperazine hydrochloride Chemical Properties |
| Melting point | 217-219 °C(lit.) | | Boiling point | 130-133C | | density | 1.106g/cm | | refractive index | 1,574-1,576 | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Soluble in DMSO and Methanol. | | form | A crystalline solid | | Sensitive | Hygroscopic | | BRN | 4276925 | | InChI | InChI=1S/C11H16N2O.ClH/c1-14-11-5-3-2-4-10(11)13-8-6-12-7-9-13;/h2-5,12H,6-9H2,1H3;1H | | InChIKey | DDMVHGULHRJOEC-UHFFFAOYSA-N | | SMILES | N1(C2=CC=CC=C2OC)CCNCC1.[H]Cl | | CAS DataBase Reference | 5464-78-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-28A | | RIDADR | UN2811 | | WGK Germany | 3 | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29335990 |
| | 1-(2-Methoxyphenyl)piperazine hydrochloride Usage And Synthesis |
| Chemical Properties | 1-(2-Methoxyphenyl)piperazine hydrochloride is Off-White Solid | | Uses | 1-(2-Methoxyphenyl)piperazine hydrochloride is used as reference material for forensic laboratories. It is used in chemical synthesis studies. | | Synthesis | Procedure for the synthesis of compound 6: In a double necked round bottom flask (RB flask), tert-butyl 4-(2-methoxyphenyl)piperazine-1-carboxylate (Compound 5, 0.600 g, 0.00205 mol, 1 equiv.) was dissolved in ethyl ether (10 mL) followed by addition of ethyl ether hydrochloric acid solution. The reaction mixture was stirred at room temperature overnight. The progress of the reaction was monitored by thin layer chromatography (TLC) and after confirming complete consumption of the raw material, the ether was removed by evaporation under reduced pressure to give a solid product. The solid product was washed with ethyl acetate and then dried to give the final 1-(2-methoxyphenyl)piperazine hydrochloride (compound 6) as a white solid (0.425 g, 90.08% yield). | | References | [1] Patent: US2010/331307, 2010, A1. Location in patent: Page/Page column 19
[2] Patent: WO2011/72174, 2011, A1. Location in patent: Page/Page column 100
[3] Patent: WO2012/3418, 2012, A2. Location in patent: Page/Page column 92 |
| | 1-(2-Methoxyphenyl)piperazine hydrochloride Preparation Products And Raw materials |
|