| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:(4S)-4-[(1R)-2-Azido-1-(benzyloxy)ethyl]-2,2-diMethyl-1,3-dioxolane CAS:1228077-93-7 Package:1G
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:(4S)-4-[(1R)-2-Azido-1-(benzyloxy)ethyl]-2,2-dimethyl-1,3-dioxolane CAS:1228077-93-7 Purity:(4S)-4-[(1R)-2-Azido-1-(benzyloxy)ethyl]-2,2-dimethyl-1,3-di Package:1G Remarks:573213-1G
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:(4S)-4-[(1R)-2-Azido-1-(benzyloxy)ethyl]-2,2-dimethyl-1,3-dioxolane CAS:1228077-93-7
|
| Company Name: |
Santa Cruz Biotechnology Inc
|
| Tel: |
021-60936350 |
| Email: |
scbt@scbt.com |
| Products Intro: |
Product Name:(4S)-4-[(1R)-2-Azido-1-(benzyloxy)ethyl]-2,2-dimethyl-1,3-dioxolane CAS:1228077-93-7
|
|
| | (4S)-4-[(1R)-2-AZIDO-1-(BENZYLOXY)ETHYL]-2,2-DIMETHYL-1,3-DIOXOLANE Basic information |
| | (4S)-4-[(1R)-2-AZIDO-1-(BENZYLOXY)ETHYL]-2,2-DIMETHYL-1,3-DIOXOLANE Chemical Properties |
| density | 1.116 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.5090(lit.) | | Fp | 218 °F | | storage temp. | 2-8°C | | Optical Rotation | [α]20/D +13°, neat | | InChI | 1S/C14H19N3O3/c1-14(2)19-10-13(20-14)12(8-16-17-15)18-9-11-6-4-3-5-7-11/h3-7,12-13H,8-10H2,1-2H3/t12-,13+/m1/s1 | | InChIKey | YWANFIYHLHBBCF-OLZOCXBDSA-N | | SMILES | CC1(C)OC[C@H](O1)[C@@H](CN=[N+]=[N-])OCc2ccccc2 |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 36 | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral |
| | (4S)-4-[(1R)-2-AZIDO-1-(BENZYLOXY)ETHYL]-2,2-DIMETHYL-1,3-DIOXOLANE Usage And Synthesis |
| reaction suitability | reaction type: click chemistry |
| | (4S)-4-[(1R)-2-AZIDO-1-(BENZYLOXY)ETHYL]-2,2-DIMETHYL-1,3-DIOXOLANE Preparation Products And Raw materials |
|