ETHYL CIS-3-BROMOACRYLATE manufacturers
|
| | ETHYL CIS-3-BROMOACRYLATE Basic information |
| Product Name: | ETHYL CIS-3-BROMOACRYLATE | | Synonyms: | ETHYL (Z)-3-BROMO-2-PROPENOATE;ETHYL CIS-3-BROMOACRYLATE;CIS-3-BROMOACRYLIC ACID ETHYL ESTER;(2Z)-3-Bromoacrylic acid ethyl ester;(2Z)-3-Bromopropenoic acid ethyl ester;(Z)-3-Bromoacrylic acid ethyl ester;(Z)-3-Bromopropenoic acid ethyl ester;Ethyl (Z)-3-bromo-2-propenoate,99% | | CAS: | 31930-34-4 | | MF: | C5H7BrO2 | | MW: | 179.01 | | EINECS: | | | Product Categories: | C2 to C5;Carbonyl Compounds;Esters | | Mol File: | 31930-34-4.mol |  |
| | ETHYL CIS-3-BROMOACRYLATE Chemical Properties |
| Boiling point | 75 °C (12 mmHg) | | density | 1.48 g/mL at 20 °C | | refractive index | n20/D 1.481 | | Fp | 59.00°C | | storage temp. | 2-8°C | | solubility | soluble in Methanol | | form | clear liquid | | color | Colorless to Almost colorless | | BRN | 1902817 | | InChI | InChI=1S/C5H7BrO2/c1-2-8-5(7)3-4-6/h3-4H,2H2,1H3/b4-3- | | InChIKey | UJTJVQIYRQALIK-ARJAWSKDSA-N | | SMILES | C(OCC)(=O)/C=C\Br |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-52/53-22 | | Safety Statements | 26-36-61 | | RIDADR | UN 3082 9/PG 3 | | WGK Germany | 3 | | F | 19 | | HazardClass | 3 | | PackingGroup | III | | HS Code | 29161900 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | ETHYL CIS-3-BROMOACRYLATE Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | Uses | Ethyl cis-3-Bromoacrylate acts as a reagent in the synthetic preparation of aristeromycin and also in the preparation of lipoxin derivatives as new anti-inflammatory compounds. | | Uses | Ethyl cis-3-bromoacrylate was used in the preparation of ethyl 2-amino-9-(2-deoxy-β-D-erythropentofuranosyl)-6,9-dihydro-6-oxo-1H-purine-1-acrylate. It was used in the synthesis of 3-(2-deoxy-β-D-erythro-pentofuranosyl)-3,4-dihydropyrimido[1,2-a]purine-6,10-dione. It was employed as building block for the stereoselective preparation of cis-2-enoates. |
| | ETHYL CIS-3-BROMOACRYLATE Preparation Products And Raw materials |
|