|
|
| | 3-Glycidoxypropyldimethoxymethylsilane Basic information |
| | 3-Glycidoxypropyldimethoxymethylsilane Chemical Properties |
| Boiling point | 100 °C4 mm Hg(lit.) | | density | 1.02 g/mL at 25 °C(lit.) | | vapor pressure | 3Pa at 25℃ | | refractive index | n20/D 1.432(lit.) | | Fp | 221 °F | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | liquid | | color | Colorless to Light yellow | | Specific Gravity | 1.02 | | Water Solubility | 12g/L at 20℃ | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | InChI | InChI=1S/C9H20O4Si/c1-10-14(3,11-2)6-4-5-12-7-9-8-13-9/h9H,4-8H2,1-3H3 | | InChIKey | WHGNXNCOTZPEEK-UHFFFAOYSA-N | | SMILES | C(C1OC1)OCCC[Si](C)(OC)OC | | LogP | 1.7 at 20℃ | | CAS DataBase Reference | 65799-47-5(CAS DataBase Reference) |
| Risk Statements | 36/37/38 | | Safety Statements | 36/37/39-45 | | WGK Germany | 3 | | TSCA | No | | HS Code | 29319090 | | Storage Class | 10 - Combustible liquids |
| | 3-Glycidoxypropyldimethoxymethylsilane Usage And Synthesis |
| Chemical Properties | Colorless clear liquid | | Uses | The usual cure time is 16-20 hours at room temperature or 1 hour at 100C. | | General Description | 3-Glycidoxypropyldimethoxymethylsilane (GDMMS) is an epoxy-silane that is used to form a silane based coupling agent for functionalization of a variety of substrates. The epoxy groups allow good adhesion of surface atoms and form a stable polymeric structure. | | Flammability and Explosibility | Not classified |
| | 3-Glycidoxypropyldimethoxymethylsilane Preparation Products And Raw materials |
|