| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (1S,3S)-3-Acetyl-2,2-dimethylcyclobutane acetonitrile Basic information |
| Product Name: | (1S,3S)-3-Acetyl-2,2-dimethylcyclobutane acetonitrile | | Synonyms: | 2-((1S,3S)-3-Acetyl-2,2-dimethylcyclobutyl)acetonitrile;Mixtureofca.90:10Z/E;(1S,3S)-3-ACETYL-2,2-DIMETHYLCYCLOBUTANEACETONITRILE MIXT. OF CA. 90:10 Z E 98%;(1S,3S)-3-ACETYL-2,2-DIMETHYLCYCLOBUTANEACETONITRILE, 98%, MIXT. OF CA. 90:10 Z/E;(1S,3S)-3-Acetyl-2,2-dimethylcyclobutaneacetonitrile, mixt. of ca. 90:10 Z/E;Cyclobutaneacetonitrile, 3-acetyl-2,2-dimethyl-, (1S,3S)-;(1S,3S)-3-Acetyl-2,2-dimethylcyclobutane acetonitrile | | CAS: | 39863-94-0 | | MF: | C10H15NO | | MW: | 165.23 | | EINECS: | | | Product Categories: | | | Mol File: | 39863-94-0.mol |  |
| | (1S,3S)-3-Acetyl-2,2-dimethylcyclobutane acetonitrile Chemical Properties |
| Boiling point | 111-113 °C (4 mmHg) | | density | 0.96 | | refractive index | 1.463-1.465 | | storage temp. | Refrigerator (+4°C) | | form | solid | | InChI | 1S/C10H15NO/c1-7(12)9-6-8(4-5-11)10(9,2)3/h8-9H,4,6H2,1-3H3/t8-,9-/m1/s1 | | InChIKey | VILTYDDIGXXGBZ-RKDXNWHRSA-N | | SMILES | CC1(C)[C@@](C[C@]1(CC#N)[H])([H])C(C)=O |
| Hazard Codes | Xn,T | | Risk Statements | 20/21/22-25 | | Safety Statements | 24/25-45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | WGK 3 | | HS Code | 29269095 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| Provider | Language |
|
ACROS
| English |
| | (1S,3S)-3-Acetyl-2,2-dimethylcyclobutane acetonitrile Usage And Synthesis |
| Chemical Properties | CLEAR YELLOW LIQUID |
| | (1S,3S)-3-Acetyl-2,2-dimethylcyclobutane acetonitrile Preparation Products And Raw materials |
|