- H-HYP(TBU)-OH
-
- $1.00 / 1KG
-
2019-07-06
- CAS:79775-07-8
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20kg
|
| | H-HYP(TBU)-OH Basic information |
| Product Name: | H-HYP(TBU)-OH | | Synonyms: | O-tert-Butyl-L-4-hydroxyproline;O-T-BUTYL-TRANS-4-HYDROXY-L-PROLINE;O-T-BUTYL-L-4-HYDROXYPROLINE;O-T-BUTYL-L-4-TRANS-HYDROXYPROLINE;L-4-HYDROXYPROLINE TERT-BUTYL;H-HYP(TBU)-OH;HYDROXYPROLINE(TBU)-OH;L-Hyp(tBu)-OH | | CAS: | 79775-07-8 | | MF: | C9H17NO3 | | MW: | 187.24 | | EINECS: | | | Product Categories: | | | Mol File: | 79775-07-8.mol |  |
| | H-HYP(TBU)-OH Chemical Properties |
| Melting point | 204-206℃ | | Boiling point | 300.5±42.0 °C(Predicted) | | density | 1.10±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Powder | | pka | 2.11±0.40(Predicted) | | color | White to off-white | | InChI | InChI=1S/C9H17NO3/c1-9(2,3)13-6-4-7(8(11)12)10-5-6/h6-7,10H,4-5H2,1-3H3,(H,11,12)/t6-,7+/m1/s1 | | InChIKey | XTQZONYRNXFGCY-RQJHMYQMSA-N | | SMILES | C(O)(=O)[C@@H]1C[C@@H](OC(C)(C)C)CN1 |
| | H-HYP(TBU)-OH Usage And Synthesis |
| Uses | H-Hyp(tBu)-OH is a proline derivative[1]. | | References | [1] Luckose F, et al. Effects of amino acid derivatives on physical, mental, and physiological activities. Crit Rev Food Sci Nutr. 2015;55(13):1793-1144. DOI:10.1080/10408398.2012.708368 |
| | H-HYP(TBU)-OH Preparation Products And Raw materials |
|