3-Chloro-4-(pyridin-3-yl)-1,2,5-thiadiazole manufacturers
|
| | 3-Chloro-4-(pyridin-3-yl)-1,2,5-thiadiazole Basic information |
| Product Name: | 3-Chloro-4-(pyridin-3-yl)-1,2,5-thiadiazole | | Synonyms: | 3-CHLORO-4-(PYRIDIN-3-YL)-1,2,5-THIADIAZOLE;3-Chloro-4-(3-pyridyl)-1,2,5-thiadiazole, 95%;Pyridine, 3-(4-chloro-1,2,5-thiadiazol-3-yl)-;3-(3-chloro-1,2,5-thiadiazol-4yl)pyridine;3-Chloro-4-(3-pyridyl)-1,2,5-thiadiazole,95%;Xanomeline intermediate 1;3-Chloro-4-(3-pyridyl)-1,2,5-thiadiazole;3-(3-chlorine-1,2,5-Thiadiazole-4-base)-Pyridine | | CAS: | 131986-28-2 | | MF: | C7H4ClN3S | | MW: | 197.64 | | EINECS: | 681-123-2 | | Product Categories: | | | Mol File: | 131986-28-2.mol |  |
| | 3-Chloro-4-(pyridin-3-yl)-1,2,5-thiadiazole Chemical Properties |
| Melting point | 56℃ | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | InChI | InChI=1S/C7H4ClN3S/c8-7-6(10-12-11-7)5-2-1-3-9-4-5/h1-4H | | InChIKey | CMPNWGQBNRHIQZ-UHFFFAOYSA-N | | SMILES | C1=NC=CC=C1C1C(Cl)=NSN=1 |
| Hazard Codes | Xi | | Risk Statements | 41 | | Safety Statements | 26-39 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Eye Dam. 1 |
| | 3-Chloro-4-(pyridin-3-yl)-1,2,5-thiadiazole Usage And Synthesis |
| Chemical Properties | White to cream. | | Uses | 3-Chloro-4-(pyridin-3-yl)-1,2,5-thiadiazole can be used to treat neurological disorders. | | Definition | ChEBI: 3-Chloro-4-(pyridin-3-yl)-1,2,5-thiadiazole is a member of pyridines. |
| | 3-Chloro-4-(pyridin-3-yl)-1,2,5-thiadiazole Preparation Products And Raw materials |
|