|
|
| | 2,4,5,6-Tetraaminopyrimidine dihydrochloride Basic information |
| Product Name: | 2,4,5,6-Tetraaminopyrimidine dihydrochloride | | Synonyms: | 2,4,5,6-Tetraaminopyrimidine2HCL;pyriMidine-2,4,5,6-tetraMine dihydrochloride;2,4,5,6-TetraaMinopyriMidine diydrochloride;Pyrimidine-2,4,5,6-tetraamine dihydrochloride;2,4,5,6-Tetraaminopyrimidine dihydrochloride;Pyrimidinetetramine, hydrochloride;pyrimidine-2,4,5,6-tetramine hydrochloride;2,4,5,6-Pyrimidinetetramine, hydrochloride (1:?) | | CAS: | 39944-62-2 | | MF: | C4H9ClN6 | | MW: | 176.61 | | EINECS: | 619-990-6 | | Product Categories: | Pyrimidines;bc0001 | | Mol File: | 39944-62-2.mol |  |
| | 2,4,5,6-Tetraaminopyrimidine dihydrochloride Chemical Properties |
| InChI | InChI=1S/C4H8N6.ClH/c5-1-2(6)9-4(8)10-3(1)7;/h5H2,(H6,6,7,8,9,10);1H | | InChIKey | AGTIQJILUCODGM-UHFFFAOYSA-N | | SMILES | NC1=C(N=C(N)N=C1N)N.Cl | | CAS DataBase Reference | 39944-62-2(CAS DataBase Reference) |
| | 2,4,5,6-Tetraaminopyrimidine dihydrochloride Usage And Synthesis |
| Uses | 2,4,5,6-Tetraaminopyrimidine dihydrochloride is the hydrochloride of 2,4,5,6-Tetraaminopyrimidine. The compound is light yellow to off-white crystals. It is a crucial compound that could be used as a pharmaceutical intermediate in pharmaceutical synthesis and scientific research.
|
| | 2,4,5,6-Tetraaminopyrimidine dihydrochloride Preparation Products And Raw materials |
|