|
|
| | Sodium hexamethylene-1,6-bisthiosulfate dihydrate Basic information |
| Product Name: | Sodium hexamethylene-1,6-bisthiosulfate dihydrate | | Synonyms: | Thiosulfuricacid(H2S2O3),S,S’-1,6-hexanediylester,disodiumsalt;Hexamethylene-1,6-di-sodiumthiosalfate,dihydrate;hexamethylene-1,6-bis(thiosulfate), disodium, dihydrate;disodium 1,6-bis(sulfonatosulfanyl)hexane;disodium 1,6-bis(sulfonatothio)hexane;1,6-HEXAMETHYLENE BIS(SODIUM THIOSULFATE);Thiosulfuric acid, S,S'-1,6-hexanediyl ester, disodium salt;SODIUM HEXAMETHYLENE-1,6-BISTHIOSULFATE DIHYDRATE | | CAS: | 5719-73-3 | | MF: | C6H12Na2O6S4 | | MW: | 354.4 | | EINECS: | | | Product Categories: | Rubber & Plastic Auxiliary Agent | | Mol File: | 5719-73-3.mol |  |
| | Sodium hexamethylene-1,6-bisthiosulfate dihydrate Chemical Properties |
| InChI | InChI=1S/C6H14O6S4.2Na/c7-15(8,13)11-5-3-1-2-4-6-12-16(9,10)14;;/h1-6H2,(H,7,8,13)(H,9,10,14);;/q;2*+1/p-2 | | InChIKey | NPPPRXSQJZPQHY-UHFFFAOYSA-L | | SMILES | S(OCCCCCCOS(=O)(=O)S[Na])(=O)(=O)S[Na] | | EPA Substance Registry System | Thiosulfuric acid (H2S2O3), S,S'-1,6-hexanediyl ester, disodium salt (5719-73-3) |
| | Sodium hexamethylene-1,6-bisthiosulfate dihydrate Usage And Synthesis |
| Chemical Properties | White powder |
| | Sodium hexamethylene-1,6-bisthiosulfate dihydrate Preparation Products And Raw materials |
|