|
|
| | 3,3-Diethoxypropionitrile Basic information |
| | 3,3-Diethoxypropionitrile Chemical Properties |
| Melting point | 82-84 | | Boiling point | 91-93 °C/11 mmHg (lit.) | | density | 0.954 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.415(lit.) | | Fp | 183 °F | | storage temp. | Inert atmosphere,2-8°C | | solubility | 32g/l | | form | Oil | | color | Clear Colourless to Pale Yellow | | InChI | InChI=1S/C7H13NO2/c1-3-9-7(5-6-8)10-4-2/h7H,3-5H2,1-2H3 | | InChIKey | WBOXEOCWOCJQNK-UHFFFAOYSA-N | | SMILES | C(#N)CC(OCC)OCC | | CAS DataBase Reference | 2032-34-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | 3275 | | WGK Germany | 2 | | Hazard Note | Irritant | | HS Code | 29269095 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3,3-Diethoxypropionitrile Usage And Synthesis |
| Chemical Properties | CLEAR YELLOW TO BROWNISH LIQUID | | Uses | 3,3-Diethoxypropionitrile is a propionitrile derivative used in the preparation of various biologically active compounds such as p38α mitogen-activated protein kinase inhibitors. | | Uses | 3,3-Diethoxypropionitrile may be used in the synthesis of 2-(2,2-diethoxy-ethyl)-pyridine, via [2+2+2]-cycloaddition reaction. It may be used in the synthesis of cyanomalondialdehyde. | | Synthesis Reference(s) | Journal of the American Chemical Society, 69, p. 2657, 1947 DOI: 10.1021/ja01203a028 | | General Description | 3,3-Diethoxypropionitrile is a cyanide derivative. It undergoes reaction with urea in refluxing butanolic sodium butoxide to afford 4-amino-2(1H)-pyrimidinone and cytosine. Its physical properties (density, refractive index, boiling point and melting point) have been reported. |
| | 3,3-Diethoxypropionitrile Preparation Products And Raw materials |
|