- ALLYLTRIPHENYLSILANE
-
- $2.00 / 1KG
-
2019-07-06
- CAS:18752-21-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: customsie
|
| | ALLYLTRIPHENYLSILANE Basic information | | Uses |
| | ALLYLTRIPHENYLSILANE Chemical Properties |
| Melting point | 87-90 °C (lit.) | | Boiling point | 190 °C(Press: 5 Torr) | | density | 1.03±0.1 g/cm3(Predicted) | | Hydrolytic Sensitivity | 2: reacts with aqueous acid | | BRN | 2941926 | | InChI | 1S/C21H20Si/c1-2-18-22(19-12-6-3-7-13-19,20-14-8-4-9-15-20)21-16-10-5-11-17-21/h2-17H,1,18H2 | | InChIKey | DXJZZRSMGLGFPW-UHFFFAOYSA-N | | SMILES | C=CC[Si](c1ccccc1)(c2ccccc2)c3ccccc3 |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | TSCA | No | | Storage Class | 11 - Combustible Solids |
| | ALLYLTRIPHENYLSILANE Usage And Synthesis |
| Uses | Allylsilanes are a commonly used class of silicon reagents and continue to be widely used in synthesis. |
| | ALLYLTRIPHENYLSILANE Preparation Products And Raw materials |
|