TRANS-1-METHYL-4-CARBOXY-5-(3-PYRIDYL)-2-PYRROLIDINONE manufacturers
|
| | TRANS-1-METHYL-4-CARBOXY-5-(3-PYRIDYL)-2-PYRROLIDINONE Basic information |
| | TRANS-1-METHYL-4-CARBOXY-5-(3-PYRIDYL)-2-PYRROLIDINONE Chemical Properties |
| Melting point | 194-195 °C(lit.) | | Boiling point | 483.8±45.0 °C(Predicted) | | density | 1.327±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | pka | 3.94±0.40(Predicted) | | InChI | 1S/C11H12N2O3/c1-13-9(14)5-8(11(15)16)10(13)7-3-2-4-12-6-7/h2-4,6,8,10H,5H2,1H3,(H,15,16)/t8-,10+/m0/s1 | | InChIKey | DEYLVDCFTICBTB-WCBMZHEXSA-N | | SMILES | CN1[C@@H]([C@H](CC1=O)C(O)=O)c2cccnc2 | | CAS DataBase Reference | 33224-01-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HS Code | 2933.79.8500 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | TRANS-1-METHYL-4-CARBOXY-5-(3-PYRIDYL)-2-PYRROLIDINONE Usage And Synthesis |
| Chemical Properties | White Crystalline Solid | | Uses | A major metabolite of nicotine in humans | | Uses | trans-4-Cotininecarboxylic acid was used in the preparation of cotinine-conjugated horseradish peroxidase during immunoblot analysis. Anion of trans-4-cotininecarboxylic acid has been employed as pyridyl-carboxylate ligand in the preparation of polymeric copper(II) complex. | | General Description | Carboxyl group of trans-4-cotininecarboxylic acid (carboxycotinine) can be used for chemical crosslinking. |
| | TRANS-1-METHYL-4-CARBOXY-5-(3-PYRIDYL)-2-PYRROLIDINONE Preparation Products And Raw materials |
|