|
|
| | 3-Hydroxyphenylboronic acid Basic information |
| | 3-Hydroxyphenylboronic acid Chemical Properties |
| Melting point | 210-213 °C (dec.) (lit.) | | Boiling point | 370.0±44.0 °C(Predicted) | | density | 1.32±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | Crystalline Powder, Crystals and/or Chunks | | pka | pK1:8.55;pK2:10.84 (25°C) | | color | Pink to gray to tan | | BRN | 3240771 | | InChI | InChI=1S/C6H7BO3/c8-6-3-1-2-5(4-6)7(9)10/h1-4,8-10H | | InChIKey | WFWQWTPAPNEOFE-UHFFFAOYSA-N | | SMILES | B(C1=CC=CC(O)=C1)(O)O | | CAS DataBase Reference | 87199-18-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-22 | | Safety Statements | 37/39-26-36/37/39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29319090 | | Storage Class | 11 - Combustible Solids |
| | 3-Hydroxyphenylboronic acid Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | Uses | suzuki reaction | | Uses | 3-Hydroxyphenylboronic acid (3-HPBA) can be used as a reagent:
- In Suzuki-Miyaura coupling reactions with aryl halides for the formation of C-C bond in the presence of Pd catalyst.
- To synthesize boron/nitrogen-doped polymer nano/microspheres by hydrothermal polymerization with formaldehyde and ammonia.
- To prepare carbon quantum dots based on 3-HPBA as selective fructose sensor.
- In the development of modified electrodes for electrochemical biosensors.
| | Synthesis | (vi) Preparation of 3-hydroxyphenylboronic acid: m-Bromophenol (8.65 g, 50 mmol) was dissolved in anhydrous tetrahydrofuran (150 mL) and sodium hydride (60%, 2.4 g, 60 mmol) was added at room temperature. After 1 hour of reaction, sec-butyl lithium (1.3 M, 50 mL, 65 mmol) was added slowly and dropwise to the reaction solution at -78 °C. Stirring was continued at this temperature for 30 min, followed by the addition of trimethyl borate (15 mL). The reaction system was gradually warmed to room temperature and maintained for 2 hours. Upon completion of the reaction, the reaction was quenched with deionized water (50 mL) and extracted with dichloromethane (2 x 100 mL). The organic phases were combined, dried with anhydrous magnesium sulfate and concentrated under reduced pressure to afford 3-hydroxyphenylboronic acid as a white solid (4.0 g, 58% yield), and the product was used directly in the subsequent Suzuki coupling reaction without further purification. | | References | [1] Patent: US2003/187022, 2003, A1 |
| | 3-Hydroxyphenylboronic acid Preparation Products And Raw materials |
|