|
|
| | 2-(4-BIPHENYLYL)-5-PHENYL-1,3,4-OXADIAZOLE Basic information |
| Product Name: | 2-(4-BIPHENYLYL)-5-PHENYL-1,3,4-OXADIAZOLE | | Synonyms: | 2-PHENYL-5-(4-BIPHENYLYL)-1,3,4-OXADIAZOLE;2-(4-DIPHENYL)-5-PHENYL-1,3,4-OXADIZOLE;2-(4-BIPHENYLYL)-5-PHENYL-1,3,4-OXADIAZOLE;2-(4-BIPHENYL)-5-PHENYL-1,3,4-OXADIAZOLE;5-PHENYL-2-(4-BIPHENYLYL)-1,3,4-OXADIAZOLE;PBD;2-(4-Biphenylyl)-5-phenyloxadiazole;PBD, 99%, scintillation grade | | CAS: | 852-38-0 | | MF: | C20H14N2O | | MW: | 298.34 | | EINECS: | 212-712-0 | | Product Categories: | Biphenyl derivatives | | Mol File: | 852-38-0.mol |  |
| | 2-(4-BIPHENYLYL)-5-PHENYL-1,3,4-OXADIAZOLE Chemical Properties |
| Melting point | 167-169 °C(lit.) | | Boiling point | 439.76°C (rough estimate) | | density | 1.1743 (rough estimate) | | refractive index | 1.5700 (estimate) | | storage temp. | 2-8°C | | pka | -5.17±0.37(Predicted) | | form | powder | | BRN | 252554 | | InChI | 1S/C20H14N2O/c1-3-7-15(8-4-1)16-11-13-18(14-12-16)20-22-21-19(23-20)17-9-5-2-6-10-17/h1-14H | | InChIKey | WMAXWOOEPJQXEB-UHFFFAOYSA-N | | SMILES | c1ccc(cc1)-c2ccc(cc2)-c3nnc(o3)-c4ccccc4 | | CAS DataBase Reference | 852-38-0(CAS DataBase Reference) | | EPA Substance Registry System | 1,3,4-Oxadiazole, 2-[1,1'-biphenyl]-4-yl-5-phenyl- (852-38-0) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids |
| | 2-(4-BIPHENYLYL)-5-PHENYL-1,3,4-OXADIAZOLE Usage And Synthesis |
| Description | 2-(4-Biphenylyl)-5-phenyl-1,3,4-oxadiazole is a small-molecule laser dye. | | Chemical Properties | white fine crystalline powder | | Uses | Suitable as laser dye | | Application | Suitable as a laser dye. | | Purification Methods | PBD is recrystallised from toluene. It is a good scintillation material [Brown et al. Discussion Faraday Soc 27 43 1959]. [Beilstein 27 III/IV 7283.] |
| | 2-(4-BIPHENYLYL)-5-PHENYL-1,3,4-OXADIAZOLE Preparation Products And Raw materials |
|