| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| Product Name: | AZADO | | Synonyms: | 2-Azaadamantane-N-oxyl 96%;N-Oxyl-2-azaadamantane;AZADO;2-Azatricyclo[3.3.1.13,7]dec-2-yloxidanyl;2-Azaadamantane-N-oxyl;2-Azaadamantane-N-oxyl | | CAS: | 57625-08-8 | | MF: | C9H14NO | | MW: | 152.22 | | EINECS: | | | Product Categories: | | | Mol File: | 57625-08-8.mol |  |
| | AZADO Chemical Properties |
| Melting point | 182-189 °C (D) | | storage temp. | 2-8°C | | form | powder | | InChI | 1S/C9H14NO/c11-10-8-2-6-1-7(4-8)5-9(10)3-6/h6-9H,1-5H2/t6-,7+,8-,9+ | | InChIKey | BCJCJALHNXSXKE-SPJNRGJMSA-N | | SMILES | [O]N1[C@@H]2C[C@H]3C[C@@H](C2)C[C@@H]1C3 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | AZADO Usage And Synthesis |
| Description | 2-Azaadamantane N-Oxyl (AZADO) is a less hindered nitroxyl radical, that exhibits an enhanced reactivity compared with TEMPO. | | Uses | 2-Azaadamantane-N-oxyl (AZADO) may be employed in the following studies:
As catalyst for the oxidation of wood cellulose.
As catalyst in the total synthesis of Yaku′amide A, a potential cytotoxin obtained from sponge Ceratopsion sp.
As oxidant for the oxidation of (S)-glycidol. | | General Description | 2-Azaadamantane-N-oxyl (AZADO), a stable nitroxyl radical, is widely employed as catalyst for the oxidation of alcohols. | | reaction suitability | reagent type: oxidant |
| | AZADO Preparation Products And Raw materials |
|