|
|
| | Diacetato[(R)-(+)-2,2'-bis(diphenylphosphino)-1,1'-binaphthyl]ruthenium(II) Basic information | | Reaction |
| Product Name: | Diacetato[(R)-(+)-2,2'-bis(diphenylphosphino)-1,1'-binaphthyl]ruthenium(II) | | Synonyms: | Diacetato[(R)-(+)-2,2'-bis(diphenylphosphino)-1,1'-binaphthyl]ruthenium(II);(R)-Ru(OAc)2(BINAP),Diacetato[(R)-(+)-2,2′-bis(diphenylphosphino)-1,1′binaphthyl]ruthenium(II);Diacetato[(R)-(+)-2,2'-bis(diphenylphosphino)-1,1'-binaphthyl]ruthenium(II) Ru(OAc)2[(R)-binap];RU(OAC)2[(R)-BINAP];Ru(OAc)2[(R)-binap];-binaphthyl]ruthenium(II),Ru(OAc)2[(R)-binap].;(R)-Ru(OAc)2(BINAP),Diacetato[(R)-(+)-2,2bis(diphenylphosphino)-1,1inaphthyl]ruthenium(II);Diacetato[(R | | CAS: | 325146-81-4 | | MF: | C48H40O4P2Ru | | MW: | 843.86 | | EINECS: | | | Product Categories: | Ru | | Mol File: | 325146-81-4.mol | ![Diacetato[(R)-(+)-2,2'-bis(diphenylphosphino)-1,1'-binaphthyl]ruthenium(II) Structure](CAS/20181022/GIF/325146-81-4.gif) |
| | Diacetato[(R)-(+)-2,2'-bis(diphenylphosphino)-1,1'-binaphthyl]ruthenium(II) Chemical Properties |
| Melting point | >100°C | | storage temp. | 2-8°C | | form | Powder | | color | ocher to green | | Sensitive | air sensitive | | InChIKey | XANQJWCSQJDBEA-UHFFFAOYSA-N | | SMILES | CC1=O[Ru+2]23(O=C(C)[O-]2)(P(C2C=CC=CC=2)(C2C=CC=CC=2)C2=CC=C4C=CC=CC4=C2C2=C4C=CC=CC4=CC=C2P3(C2C=CC=CC=2)C2C=CC=CC=2)[O-]1 |
| WGK Germany | 3 | | HS Code | 28439000 | | Storage Class | 11 - Combustible Solids |
| | Diacetato[(R)-(+)-2,2'-bis(diphenylphosphino)-1,1'-binaphthyl]ruthenium(II) Usage And Synthesis |
| Reaction |
- Catalyst system that exhibits very high catalytic activity and enantioselectivity in the hydrogenation of a wide range of substrates.
- Catalyst used in the synthesis of β-amino acids by hydrogenation.
| | Chemical Properties | Light yellow powder | | Uses | (R)-Ru(OAc)2(BINAP) is a catalyst. |
| | Diacetato[(R)-(+)-2,2'-bis(diphenylphosphino)-1,1'-binaphthyl]ruthenium(II) Preparation Products And Raw materials |
|