| Company Name: |
Mainchem Co., Ltd.
|
| Tel: |
+86-0592-6210733 |
| Email: |
sale@mainchem.com |
| Products Intro: |
Product Name:Epitestosterone
CAS:481-30-1
|
|
| | Epitestosterone Basic information |
| | Epitestosterone Chemical Properties |
| Melting point | 218-220C | | Boiling point | 432.9±45.0 °C(Predicted) | | density | 1.12±0.1 g/cm3(Predicted) | | Fp | 2℃ | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), Ethanol (Slightly), Methanol (Slightly) | | pka | 15.06±0.60(Predicted) | | form | Solid | | color | White to Pale Yellow | | Major Application | clinical testing | | InChI | 1S/C19H28O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h11,14-17,21H,3-10H2,1-2H3/t14-,15-,16-,17+,18-,19-/m0/s1 | | InChIKey | MUMGGOZAMZWBJJ-KZYORJDKSA-N | | SMILES | C[C@]12CC[C@H]3[C@@H](CCC4=CC(=O)CC[C@]34C)[C@@H]1CC[C@H]2O | | CAS DataBase Reference | 481-30-1(CAS DataBase Reference) | | NIST Chemistry Reference | 17Alpha-hydroxyandrost-4-en-3-one(481-30-1) | | EPA Substance Registry System | Androst-4-en-3-one, 17-hydroxy-, (17.alpha.)- (481-30-1) |
| Hazard Codes | Xn,F | | Risk Statements | 68-36-20/21/22-11 | | Safety Statements | 22-36-36/37-16 | | RIDADR | UN 1648 3 / PGII | | WGK Germany | 3 | | RTECS | BV8395600 | | HS Code | 2937290000 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2
Flam. Liq. 2 |
| | Epitestosterone Usage And Synthesis |
| Chemical Properties | Off-White to Pale Yellow Solid | | Uses | Testosterone and epitestosterone are endogenous steroids that differ in the configuration of the hydroxyl-bearing carbon at C-17.
epitestosterone is largely unclear. | | Definition | ChEBI: An androstanoid that is the C-17 epimer of testosterone. | | General Description | Epitestosterone is a stereoisomer of the hormone testosterone. Epitestosterone is often used to illicitly mask high testosterone levels in athletic drug tests. This Certified Snap-N-Spike Solution is applicable for use in LC/MS or GC/MS applications for sports testing, urine drug testing or forensic analysis. | | Biological Activity | Epitestosterone is a naturally occurring steroid, an inactive epimer of testosterone. |
| | Epitestosterone Preparation Products And Raw materials |
|