- Silane, tetrabutoxy-
-
- $1.10
-
2026-08-20
- CAS:4766-57-8
- Min. Order: 1kg
- Purity: 99%min
- Supply Ability: 100kg
|
| | Tetrabutyl orthosilicate Chemical Properties |
| Melting point | -80 °C | | Boiling point | 275 °C (lit.) | | density | 0.899 g/mL at 25 °C (lit.) | | vapor density | >1 (vs air) | | refractive index | n20/D 1.413(lit.) | | Fp | 174 °F | | storage temp. | Sealed in dry,Room Temperature | | form | liquid | | Specific Gravity | 0.9 | | color | colorless | | Water Solubility | reacts | | Sensitive | Moisture Sensitive | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | BRN | 1709274 | | InChI | 1S/C16H36O4Si/c1-5-9-13-17-21(18-14-10-6-2,19-15-11-7-3)20-16-12-8-4/h5-16H2,1-4H3 | | InChIKey | UQMOLLPKNHFRAC-UHFFFAOYSA-N | | SMILES | CCCCO[Si](OCCCC)(OCCCC)OCCCC | | CAS DataBase Reference | 4766-57-8(CAS DataBase Reference) | | NIST Chemistry Reference | Tetrabutyl silicate(4766-57-8) | | EPA Substance Registry System | Silicic acid (H4SiO4), tetrabutyl ester (4766-57-8) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39-37/39 | | RIDADR | UN2924 | | WGK Germany | 3 | | F | 10-21 | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29209090 | | Storage Class | 10 - Combustible liquids |
| | Tetrabutyl orthosilicate Usage And Synthesis |
| Introduction | The ethyl group of ethyl silicate is replaced by N-butyl, so the speed of hydrolysis is even slower than N-propyl silicate, and in addition to a cross-linking agent for silicon rubber, and a modifying agent for organic and inorganic resins, it can also be used as a heating medium or cooling medium by making it a condensate. There are also hopes for applications to electron donors in Ziegler-Natta catalysts. | | Chemical Properties | Colorless transparent liquid | | Uses | It is an important organic intermediate used in agrochemicals, pharmaceuticals and dyestuff fields and also in the alkylation and alkoxylation of silane. |
| | Tetrabutyl orthosilicate Preparation Products And Raw materials |
|