|
|
| | o-(Trimethylsilyl)phenol Basic information |
| | o-(Trimethylsilyl)phenol Chemical Properties |
| storage temp. | 2-8°C, stored under nitrogen | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C9H14OSi/c1-11(2,3)9-7-5-4-6-8(9)10/h4-7,10H,1-3H3 | | InChIKey | UIGHARXPLDWFHA-UHFFFAOYSA-N | | SMILES | C1(O)=CC=CC=C1[Si](C)(C)C |
| | o-(Trimethylsilyl)phenol Usage And Synthesis |
| Uses | o-(Trimethylsilyl)phenol can be used to prepare samples for analysis by gas chromatography, mass spectrometry, or nuclear magnetic resonance spectroscopy. | | Reactions | o-(Trimethylsilyl)phenol is an inorganic compound that is used as a reagent to cleave bonds, which can be achieved by the addition of sodium sulfide or ultrasonic extraction. It also reacts with o-glycosylations and fatty acids. |
| | o-(Trimethylsilyl)phenol Preparation Products And Raw materials |
| Raw materials | [(2-Bromophenyl)oxy]trimethylsilane-->Benzenethiol, 2-(trimethylsilyl)--->1-Butanesulfonic acid, 1,1,2,2,3,3,4,4,4-nonafluoro-, 2-(trimethylsilyl)phenyl ester-->trimethyl-(2-trimethylsilylphenoxy)silane-->(2-CHLOROPHENOXY)TRIMETHYLSILANE 97-->Lithium bis(trimethylsilyl)amide-->2-BROMOTHIOPHENOL-->2-Bromophenol-->2-Phenylphenol-->Chlorotrimethylsilane | | Preparation Products | 1-BENZYL-1H-BENZOTRIAZOLE-->4-(1-ADAMANTYL)PHENOL-->2-(TRIMETHYLSILYL)PHENYL TRIFLUOROMETHANESULFONATE |
|