|
|
| | 1,2:3,4-Di-O-isopropylidene-D-galactopyranose Basic information |
| Product Name: | 1,2:3,4-Di-O-isopropylidene-D-galactopyranose | | Synonyms: | DIACETONE-D-GALACTOSE;DIACETONE-ALPHA-D-GAL;1,2:3,4-DIISOPROPYLIDEN-ALPHA-D-GALACTOPYRANOSE;1,2,3,4-DI-O-ISOPROPYLIDENE-D-GALACTOPYRANOSE;1,2:3,4-DI-O-ISOPROPYLIDENE-D-GALACTOPYRANOSE;1,2:3,4-DI-O-ISOPROPYLIDENE-A-D-GALACTOPYRANOSE;1,2,3,4-DI-O-ISOPROPYLIDENE-ALPHA-D-GALACTOPYRANOSE;1,2:3,4-DI-O-ISOPROPYLIDENE-ALPHA-D-GALACTOPYRANOSE | | CAS: | 4064-06-6 | | MF: | C12H20O6 | | MW: | 260.28 | | EINECS: | 223-771-7 | | Product Categories: | carbohydrate;13C & 2H Sugars;Biochemistry;Galactose;O-Substituted Sugars;Sugars;Carbohydrates & Derivatives;Sugars, Carbohydrates & Glucosides;Glycon Biochem | | Mol File: | 4064-06-6.mol |  |
| | 1,2:3,4-Di-O-isopropylidene-D-galactopyranose Chemical Properties |
| Melting point | 120-122 °C | | alpha | -57.5 º (c=3, CHCl3) | | Boiling point | 117 °C/0.015 mmHg (lit.) | | density | 1.143 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.466(lit.) | | storage temp. | Inert atmosphere,2-8°C | | solubility | Soluble in Acetone, Chloroform and Methanol. | | pka | 14.00±0.10(Predicted) | | form | Viscous Paste | | color | Clear pale yellow to yellow | | Optical Rotation | [α]25/D 59°, c = 3 in chloroform | | BRN | 1345410 | | InChI | InChI=1/C12H20O6/c1-11(2)15-7-6(5-13)14-10-9(8(7)16-11)17-12(3,4)18-10/h6-10,13H,5H2,1-4H3/t6-,7+,8+,9-,10-/s3 | | InChIKey | POORJMIIHXHXAV-DPMQDVBJNA-N | | SMILES | [C@H]12OC(C)(C)O[C@H]1[C@H](O[C@@H]1OC(C)(C)O[C@H]21)CO |&1:0,6,7,9,15,r| | | CAS DataBase Reference | 4064-06-6(CAS DataBase Reference) | | NIST Chemistry Reference | Galactopyranose, 1,2:3,4-di-o-isopropylidene-, d-(4064-06-6) |
| | 1,2:3,4-Di-O-isopropylidene-D-galactopyranose Usage And Synthesis |
| Chemical Properties | Thick Yellow Oil | | Uses | Diacetone-D-galactose is used to produce diacetone-d-galacturonic acid and oxalic acid. It is mainly used in biochemical reaction and used as medicine intermediate. |
| | 1,2:3,4-Di-O-isopropylidene-D-galactopyranose Preparation Products And Raw materials |
|