- N-Cbz-L-histidine
-
- $1.00 / 1KG
-
2019-07-06
- CAS:14997-58-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20kg
- N-Cbz-L-histidine
-
- $7.00 / 1KG
-
2019-07-06
- CAS: 14997-58-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 100KG
|
| | N-Cbz-L-histidine Basic information |
| | N-Cbz-L-histidine Chemical Properties |
| Melting point | 168 °C (dec.)(lit.) | | alpha | -24 º (c=1 in 6 M HCl) | | Boiling point | 616.7±55.0 °C(Predicted) | | density | 1.368±0.06 g/cm3(Predicted) | | refractive index | -23.5 ° (C=6, 6mol/L HCl) | | storage temp. | Sealed in dry,2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | pka | 3.35±0.10(Predicted) | | form | powder to crystal | | color | White to Almost white | | Optical Rotation | [α]20/D 24°, c = 1% in 6 M HCl | | Water Solubility | almost transparency | | BRN | 3561682 | | Major Application | peptide synthesis | | InChI | 1S/C14H15N3O4/c18-13(19)12(6-11-7-15-9-16-11)17-14(20)21-8-10-4-2-1-3-5-10/h1-5,7,9,12H,6,8H2,(H,15,16)(H,17,20)(H,18,19)/t12-/m0/s1 | | InChIKey | WCOJOHPAKJFUDF-LBPRGKRZSA-N | | SMILES | OC(=O)[C@H](Cc1c[nH]cn1)NC(=O)OCc2ccccc2 | | CAS DataBase Reference | 14997-58-1(CAS DataBase Reference) |
| | N-Cbz-L-histidine Usage And Synthesis |
| Chemical Properties | White powder | | Uses | Nα-Cbz-L-histidine is an N-Cbz-protected form of L-Histidine (H456010). L-Histidine is an essential amino acid that plays an important role in mitochondrial glutamine transport and has potential of abolishing oxidative stress caused by brain edema.L-Histidine promotes zinc uptake in human erythrocyes and also has potential as an antioxidant therapy for acute mammary inflammation in cattle. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | N-Cbz-L-histidine Preparation Products And Raw materials |
|