|
|
| | Tetrabutylphosphonium chloride Basic information |
| | Tetrabutylphosphonium chloride Chemical Properties |
| Melting point | 62-66 °C (dec.) (lit.) | | Boiling point | 344.8℃[at 101 325 Pa] | | density | 0.978[at 20℃] | | vapor pressure | 0.018Pa at 25℃ | | refractive index | 1.5 | | Fp | 4°C (39°F) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | liquid | | color | colorless to pale-yellow | | Specific Gravity | 0.91 | | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions | | BRN | 4019186 | | Stability: | Hygroscopic | | InChI | 1S/C16H36P.ClH/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;/h5-16H2,1-4H3;1H/q+1;/p-1 | | InChIKey | IBWGNZVCJVLSHB-UHFFFAOYSA-M | | SMILES | [Cl-].CCCC[P+](CCCC)(CCCC)CCCC | | LogP | -0.44 at 23℃ | | CAS DataBase Reference | 2304-30-5(CAS DataBase Reference) | | EPA Substance Registry System | Phosphonium, tetrabutyl-, chloride (2304-30-5) |
| Hazard Codes | T | | Risk Statements | 22-24-34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 2928 6.1/PG 2 | | WGK Germany | 3 | | RTECS | TA2419000 | | F | 3-10 | | TSCA | TSCA listed | | HS Code | 2931.90.9051 | | HazardClass | 6.1(a) | | PackingGroup | II | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | | Hazard Classifications | Acute Tox. 1 Inhalation Acute Tox. 3 Dermal Acute Tox. 4 Oral Aquatic Chronic 2 Eye Dam. 1 Skin Corr. 1C Skin Sens. 1B |
| | Tetrabutylphosphonium chloride Usage And Synthesis |
| Uses | Tetrabutylphosphonium Chloride functions as inhibitor of bovine serum amine oxidase. | | Application | Tetrabutylphosphonium chloride is a green organic compound with a wide range of uses in catalysis, flame retardancy, solubility, ionic liquids and electroplating. (1) As a catalyst for organic synthesis, it can be used to prepare alkyl bromides, 2-amino-4H-chromium derivatives, and methyl ester compounds. (2) As a flame retardant additive for vinyl resins and chloroprene rubber, it is used to reduce the flammability and smoke emissions of these materials. (3) As an ionic liquid, it provides a phosphorus source for microwave-driven synthesis of nickel phosphide nanoparticles, which are then used for efficient hydrogen evolution reactions. (4) As an electroplating agent for various metals (such as copper, nickel, zinc, tin, lead, silver, gold, platinum, palladium and their alloys) to enhance the corrosion resistance and mechanical properties of metal coatings. | | General Description | This product has been enhanced for catalytic efficiency. |
| | Tetrabutylphosphonium chloride Preparation Products And Raw materials |
|