- METHYL A-FORMYLPHENYLACETATE
-
- $15.00 / 1KG
-
2021-07-13
- CAS:5894-79-1
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
- METHYL A-FORMYLPHENYLACETATE
-
- $15.00 / 1KG
-
2021-07-09
- CAS:5894-79-1
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | Methyl a-formylphenylacetate Basic information |
| Product Name: | Methyl a-formylphenylacetate | | Synonyms: | METHYL A-FORMYLPHENYLACETATE;2-Phenyl-3-oxopropionic acid methyl ester;α-Formylbenzeneacetic acid methyl ester;3-keto-2-phenyl-propionic acid methyl ester;methyl 3-oxo-2-phenylpropanoate;methyl 3-oxo-2-phenyl-propanoate;α-forMyl acid Methyl ester;Methyl 2-formylphenylacetate | | CAS: | 5894-79-1 | | MF: | C10H10O3 | | MW: | 178.19 | | EINECS: | 227-577-3 | | Product Categories: | | | Mol File: | 5894-79-1.mol |  |
| | Methyl a-formylphenylacetate Chemical Properties |
| Melting point | 104 °C | | Boiling point | 135-136 °C(Press: 14 Torr) | | density | 1.136±0.06 g/cm3(Predicted) | | pka | 6.84±0.29(Predicted) | | InChI | InChI=1S/C10H10O3/c1-13-10(12)9(7-11)8-5-3-2-4-6-8/h2-7,9H,1H3 | | InChIKey | ORJFSDFCHJQCOH-UHFFFAOYSA-N | | SMILES | C(C1C=CC=CC=1)(C=O)C(=O)OC | | EPA Substance Registry System | Benzeneacetic acid, .alpha.-formyl-, methyl ester (5894-79-1) |
| TSCA | TSCA listed | | HS Code | 2918300090 |
| | Methyl a-formylphenylacetate Usage And Synthesis |
| | Methyl a-formylphenylacetate Preparation Products And Raw materials |
|