- 3-Amino-2-bromo-4-picoline
-
- $5.00 / 1KG
-
2025-09-25
- CAS:126325-50-6
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: g-kg-tons, free sample is available
|
| | 3-Amino-2-bromo-4-picoline Basic information |
| | 3-Amino-2-bromo-4-picoline Chemical Properties |
| Boiling point | 308.0±37.0 °C(Predicted) | | density | 1.593±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 2.38±0.18(Predicted) | | form | solid | | color | Brown | | InChI | InChI=1S/C6H7BrN2/c1-4-2-3-9-6(7)5(4)8/h2-3H,8H2,1H3 | | InChIKey | RQGNAHOAQQVKDE-UHFFFAOYSA-N | | SMILES | C1(Br)=NC=CC(C)=C1N | | CAS DataBase Reference | 126325-50-6(CAS DataBase Reference) |
| | 3-Amino-2-bromo-4-picoline Usage And Synthesis |
| | 3-Amino-2-bromo-4-picoline Preparation Products And Raw materials |
|