| Company Name: |
BOC Sciences
|
| Tel: |
|
| Email: |
info@bocsci.com |
| Products Intro: |
Product Name:p-Menthane-1,8-diol
CAS:565-50-4
|
| Company Name: |
Zhuhai Anzhe Biotechnology Co,Ltd.
|
| Tel: |
13169972583 |
| Email: |
513211116@qq.com |
| Products Intro: |
Product Name:(1r,4r)-4-(2-hydroxypropan-2-yl)-1-methylcyclohexan-1-ol(trans-terpin)
CAS:565-50-4
Purity:95%HPLC Package:25mg;50mg;100mg
|
TRANS-TERPIN manufacturers
- TRANS-TERPIN
-
- $15.00 / 1KG
-
2021-07-02
- CAS:565-50-4
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | TRANS-TERPIN Basic information |
| Product Name: | TRANS-TERPIN | | Synonyms: | P-MENTHANE-1,8-DIOL;TRANS-4-(2-HYDROXYISOPROPYL)-1-METHYLCYCLOHEXANOL;TRANS-TERPIN;trans-p-Menthan-1,8-diol;TRANS-TERPIN, TERPENE STANDARD, FOR GC;standardforgc;trans-terpinterpene;4-(2-hydroxyisopropyl)-1-methylcyclohexanol | | CAS: | 565-50-4 | | MF: | C10H20O2 | | MW: | 172.26 | | EINECS: | | | Product Categories: | | | Mol File: | 565-50-4.mol |  |
| | TRANS-TERPIN Chemical Properties |
| Melting point | 115-118 °C (dec.) | | Boiling point | 265.0±8.0 °C(Predicted) | | density | 1.018±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 15.18±0.29(Predicted) | | Merck | 13,9246 | | BRN | 2204132 | | InChI | 1S/C10H20O2/c1-9(2,11)8-4-6-10(3,12)7-5-8/h8,11-12H,4-7H2,1-3H3/t8-,10- | | InChIKey | RBNWAMSGVWEHFP-CZMCAQCFSA-N | | SMILES | CC(C)(O)[C@@H]1CC[C@@](C)(O)CC1 | | LogP | 1.070 (est) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | TRANS-TERPIN Usage And Synthesis |
| Uses | Terpin impurity D EP Reference standard, intended for use in laboratory tests only as specifically prescribed in the European Pharmacopoeia. | | Definition | ChEBI: Terpin is a p-menthane monoterpenoid. | | Purification Methods | Crystallise terpin from H2O or EtOH. The anhydrous cis-isomer distils at 258o/760mm but hydrates on exposure to moist air. Anhydrous terpin is also obtained by recrystallisation from absolute EtOH. [Sword J Chem Soc 127 1632 1925, Lombard & Ambrose Bull Soc Chim Fr 230 1961, Beilstein 5 IV 435.] |
| | TRANS-TERPIN Preparation Products And Raw materials |
|