|
|
| | 4-Methoxy-L-phenylalanine Basic information |
| | 4-Methoxy-L-phenylalanine Chemical Properties |
| Melting point | 259-261 °C (dec.)(lit.) | | alpha | -8 º (c=2, 1N HCl) | | Boiling point | 331.88°C (rough estimate) | | density | 1.1926 (rough estimate) | | refractive index | 1.5150 (estimate) | | storage temp. | 2-8°C | | solubility | Aqueous Acid (Slightly, Sonicated) | | pka | 2.24±0.10(Predicted) | | form | Solid | | color | White to Off-White | | Optical Rotation | [α]25/D 7°, c = 0.5 in 1 M HCl | | Water Solubility | Very soluble in water. | | λmax | 273nm(HCl aq.)(lit.) | | BRN | 2212726 | | Major Application | peptide synthesis | | InChI | 1S/C10H13NO3/c1-14-8-4-2-7(3-5-8)6-9(11)10(12)13/h2-5,9H,6,11H2,1H3,(H,12,13)/t9-/m0/s1 | | InChIKey | GEYBMYRBIABFTA-VIFPVBQESA-N | | SMILES | COc1ccc(C[C@H](N)C(O)=O)cc1 | | CAS DataBase Reference | 6230-11-1(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 29225090 | | Storage Class | 11 - Combustible Solids |
| | 4-Methoxy-L-phenylalanine Usage And Synthesis |
| Chemical Properties | white to very slightly beige powder | | Uses | A non-natural Phenylalanine (P319415) derivative. | | Uses | O-Methyl-L-tyrosine, is used as a fine chemical intermediate. | | Definition | ChEBI: O-methyl-L-tyrosine is the L-enantiomer of O-methyltyrosine. It is an enantiomer of an O-methyl-D-tyrosine. It is a tautomer of an O-methyl-L-tyrosine zwitterion. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | 4-Methoxy-L-phenylalanine Preparation Products And Raw materials |
|