|
|
| | 17-Methyllycodin-1(18H)-one Basic information |
| Product Name: | 17-Methyllycodin-1(18H)-one | | Synonyms: | 17-Methyllycodin-1(18H)-one;β-Obscurine;beta-obscurine;β-Obscurin;1H-5,10b-Propano-1,7-phenanthrolin-8(7H)-one, 2,3,4,4a,5,6-hexahydro-1,12-dimethyl-, (4aR,5S,10bR,12R)- (9CI);β-Obscurine | | CAS: | 467-79-8 | | MF: | C17H24N2O | | MW: | 272.39 | | EINECS: | | | Product Categories: | | | Mol File: | 467-79-8.mol |  |
| | 17-Methyllycodin-1(18H)-one Chemical Properties |
| Melting point | 322-323 °C(Solv: methanol (67-56-1)) | | Boiling point | 494.0±45.0 °C(Predicted) | | density | 1.16±0.1 g/cm3(Predicted) | | pka | 13.61±0.40(Predicted) | | InChI | InChI=1S/C17H24N2O/c1-11-8-12-9-15-14(5-6-16(20)18-15)17(10-11)13(12)4-3-7-19(17)2/h5-6,11-13H,3-4,7-10H2,1-2H3,(H,18,20)/t11-,12+,13-,17-/m1/s1 | | InChIKey | SIQKNJDHWYZFFT-IPJQOSJUSA-N | | SMILES | N1(C)[C@@]23C[C@H](C)C[C@@]([H])(CC4=C2C=CC(=O)N4)[C@@]3([H])CCC1 |
| | 17-Methyllycodin-1(18H)-one Usage And Synthesis |
| Uses | β-Obscurine is a lycopodine-type alkaloid, which can be isolated from the club moss Lycopodium casuarinoides[1]. | | Definition | ChEBI: Beta-obscurine is a quinoline alkaloid and an organic heterotetracyclic compound. | | References | [1] Yin S, et al. Lycodine‐type alkaloids from Lycopodium casuarinoides[J]. Helvetica chimica acta, 2006, 89(1): 138-143. |
| | 17-Methyllycodin-1(18H)-one Preparation Products And Raw materials |
|