| Company Name: |
ANAXLABORATORIES PRIVATE LIMITED
|
| Tel: |
+91-9177075735 |
| Email: |
KIRAN.KARNATI@ANAXLAB.COM |
| Products Intro: |
Product Name:7 - methyl - 1,8 - naphthyridin - 2 - amine CAS:1568-93-0 Purity:98% Package:1 kg,5 kg, 10 kg,25kg and 1 MT
|
7-Methyl-1,8-naphthyridin-2-amine manufacturers
- AMND
-
- $0.00 / 1g
-
2019-12-20
- CAS:1568-93-0
- Min. Order: 1g
- Purity: 95%min
- Supply Ability: 20kg/month
|
| | 7-Methyl-1,8-naphthyridin-2-amine Basic information |
| Product Name: | 7-Methyl-1,8-naphthyridin-2-amine | | Synonyms: | 2-Amino-7-methyl-1,8-naphthyridine;7-Methyl-1,8-naphthyridin-2-amine;AMND;7-methyl-1,8-naphthyridin-2-amine(SALTDATA: FREE);7-Methyl-1,8-naphthyr;1,8-Naphthyridine, 2-amino-7-methyl-;2-amino-7-methyl-1, 8-naphthidine;7-methyl-1,8-naphthyridin-2-amine - [AC77915] | | CAS: | 1568-93-0 | | MF: | C9H9N3 | | MW: | 159.19 | | EINECS: | | | Product Categories: | | | Mol File: | 1568-93-0.mol |  |
| | 7-Methyl-1,8-naphthyridin-2-amine Chemical Properties |
| Melting point | 238℃ (Decomposition) | | Boiling point | 321.5±37.0 °C(Predicted) | | density | 1.238±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 5.68±0.30(Predicted) | | Appearance | Yellow to brown Solid | | InChI | InChI=1S/C9H9N3/c1-6-2-3-7-4-5-8(10)12-9(7)11-6/h2-5H,1H3,(H2,10,11,12) | | InChIKey | ZIFGWWCUONMOLI-UHFFFAOYSA-N | | SMILES | N1C2C(=CC=C(C)N=2)C=CC=1N |
| | 7-Methyl-1,8-naphthyridin-2-amine Usage And Synthesis |
| Description | 7-Methyl-1,8-naphthyridin-2-amine (AMND) is a heterocyclic amine compound. It has been shown to react with hydrochloric acid (HCl) to produce hydrogen chloride gas. AMND can also be used to prepare novel macrocyclic compounds with naphthyridine units for molecular recognition studies of biotin and urea derivatives. In addition, it was found to be highly fertile in female rats in biological studies, possibly due to its ability to stimulate the release of gonadotropins from the pituitary gland. | | Uses | 7-Methyl-1,8-naphthyridin-2-amine can be used as a designed synthetic receptor for creatinine recognition. |
| | 7-Methyl-1,8-naphthyridin-2-amine Preparation Products And Raw materials |
|