|
|
| | 2-Butynyl 4-methylbenzenesulfonate Basic information |
| Product Name: | 2-Butynyl 4-methylbenzenesulfonate | | Synonyms: | TIMTEC-BB SBB008911;2-BUTYNYL 4-TOLUENESULFONATE;2-BUTYNYL-PARA-TOLUENESULFONATE;2-BUTYNYL P-TOLUENESULFONATE;2-BUTYNYL P-TOLUENESULPHONATE;1-(p-Tosyloxy)-2-butyne;But-2-yn-1-yl 4-Methylbenzenesulfonate;-Butynyl 4-methylbenzenesulfonate | | CAS: | 56563-37-2 | | MF: | C11H12O3S | | MW: | 224.28 | | EINECS: | | | Product Categories: | | | Mol File: | 56563-37-2.mol |  |
| | 2-Butynyl 4-methylbenzenesulfonate Chemical Properties |
| Melting point | 47 °C | | Boiling point | 355.2±25.0 °C(Predicted) | | density | 1,012 g/cm3 | | Fp | >110℃ | | storage temp. | Refrigerator (+4°C) | | solubility | soluble in Methanol | | form | powder to crystal | | Specific Gravity | 1.012 | | color | White to Orange to Green | | Water Solubility | Insoluble | | BRN | 3300477 | | InChI | 1S/C11H12O3S/c1-3-4-9-14-15(12,13)11-7-5-10(2)6-8-11/h5-8H,9H2,1-2H3 | | InChIKey | HGZKJNHJABSJTC-UHFFFAOYSA-N | | SMILES | CC#CCOS(=O)(=O)c1ccc(C)cc1 | | CAS DataBase Reference | 56563-37-2(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-36/37/39-37/39 | | WGK Germany | 3 | | HS Code | 29309099 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Provider | Language |
|
ALFA
| English |
| | 2-Butynyl 4-methylbenzenesulfonate Usage And Synthesis |
| Chemical Properties | Brown crystalline powder |
| | 2-Butynyl 4-methylbenzenesulfonate Preparation Products And Raw materials |
|